ligands&coordination complexes / Alfa Chemistry
Banner
Online Inquiry
Verification code

1-Methylphosphinan-4-one 1-oxide

Catalog Number ACM54662098
CAS 54662-09-8
Synonyms 1-Methyl-1-oxo-1lambda5-phosphinan-4-one
IUPAC Name 1-methyl-1-oxo-1lambda5-phosphinan-4-one
Molecular Weight 146.12
Molecular Formula C6H11O2P
InChI ADKHHNSJNDRLHQ-UHFFFAOYSA-N
InChI Key InChI=1S/C6H11O2P/c1-9(8)4-2-6(7)3-5-9/h2-5H2,1H3
Boiling Point 358.7±31.0 °C(Predicted)
Purity 97%
Density 1.10±0.1 g/cm3(Predicted)
Isomeric SMILES CP1(=O)CCC(=O)CC1
Q&A

What is the CAS number for 1-Methylphosphinan-4-one 1-oxide?

The CAS number for 1-Methylphosphinan-4-one 1-oxide is 54662-09-8.

What is the Canonical SMILES for 1-Methylphosphinan-4-one 1-oxide?

The Canonical SMILES for 1-Methylphosphinan-4-one 1-oxide is CP1(=O)CCC(=O)CC1.

What is the molecular formula of 1-Methylphosphinan-4-one 1-oxide?

The molecular formula of 1-Methylphosphinan-4-one 1-oxide is C6H11O2P.

What is the molecular weight of 1-Methylphosphinan-4-one 1-oxide?

The molecular weight of 1-Methylphosphinan-4-one 1-oxide is 146.12 g/mol.

What is the InChIKey of 1-Methylphosphinan-4-one 1-oxide?

The InChIKey of 1-Methylphosphinan-4-one 1-oxide is ADKHHNSJNDRLHQ-UHFFFAOYSA-N.

How many hydrogen bond acceptor counts does 1-Methylphosphinan-4-one 1-oxide have?

1-Methylphosphinan-4-one 1-oxide has 2 hydrogen bond acceptor counts.

What is the XLogP3 value of 1-Methylphosphinan-4-one 1-oxide?

The XLogP3 value of 1-Methylphosphinan-4-one 1-oxide is -1.2.

What is the European Community (EC) Number for 1-Methylphosphinan-4-one 1-oxide?

The European Community (EC) Number for 1-Methylphosphinan-4-one 1-oxide is 853-761-3.

What is the IUPAC Name of 1-Methylphosphinan-4-one 1-oxide?

The IUPAC Name of 1-Methylphosphinan-4-one 1-oxide is 1-methyl-1-oxo-1λ5-phosphinan-4-one.

What are some other synonyms for 1-Methylphosphinan-4-one 1-oxide?

Some other synonyms for 1-Methylphosphinan-4-one 1-oxide are 1-methyl-1-oxo-1lambda5-phosphinan-4-one and 1-methyl-1lambda5-phosphinane-1,4-dione.

Please kindly note that our products and services are for research use only.