What is the CAS number for the compound (1-Ethoxy-1-oxopropan-2-yl)triphenylphosphonium bromide?
The CAS number is 30018-16-7.
How many hydrogen bond acceptor counts does (1-Ethoxy-1-oxopropan-2-yl)triphenylphosphonium bromide have?
It has 3 hydrogen bond acceptor counts.
What is the molecular weight of (1-Ethoxy-1-oxopropan-2-yl)triphenylphosphonium bromide?
The molecular weight is 443.3g/mol.
What is the Canonical SMILES representation of (1-Ethoxy-1-oxopropan-2-yl)triphenylphosphonium bromide?
CCOC(=O)C(C)[P+](C1=CC=CC=C1)(C2=CC=CC=C2)C3=CC=CC=C3.[Br-]
How many heavy atoms are present in (1-Ethoxy-1-oxopropan-2-yl)triphenylphosphonium bromide?
There are 27 heavy atoms.
What is the IUPAC name of (1-Ethoxy-1-oxopropan-2-yl)triphenylphosphonium bromide?
(1-ethoxy-1-oxopropan-2-yl)-triphenylphosphanium;bromide
What is the Monoisotopic Mass of (1-Ethoxy-1-oxopropan-2-yl)triphenylphosphonium bromide?
The Monoisotopic Mass is 442.06973.
How many rotatable bond counts are there in (1-Ethoxy-1-oxopropan-2-yl)triphenylphosphonium bromide?
There are 7 rotatable bond counts.
What is the Topological Polar Surface Area of (1-Ethoxy-1-oxopropan-2-yl)triphenylphosphonium bromide?
The Topological Polar Surface Area is 26.3.
What is the InChIKey of (1-Ethoxy-1-oxopropan-2-yl)triphenylphosphonium bromide?
The InChIKey is RSYXORMKBUFAMS-UHFFFAOYSA-M.