What is the IUPAC name of 1,5-Bis(diphenyphosphino)Pentane?
The IUPAC name of 1,5-Bis(diphenyphosphino)Pentane is 5-diphenylphosphanylpentyl(diphenyl)phosphane.
What is the molecular formula of 1,5-Bis(diphenyphosphino)Pentane?
The molecular formula of 1,5-Bis(diphenyphosphino)Pentane is C29H30P2.
What is the molecular weight of 1,5-Bis(diphenyphosphino)Pentane?
The molecular weight of 1,5-Bis(diphenyphosphino)Pentane is 440.5g/mol.
How many heavy atoms are present in 1,5-Bis(diphenyphosphino)Pentane?
There are 31 heavy atoms present in 1,5-Bis(diphenyphosphino)Pentane.
What is the exact mass of 1,5-Bis(diphenyphosphino)Pentane?
The exact mass of 1,5-Bis(diphenyphosphino)Pentane is 440.18227495.
What is the Canonical SMILES of 1,5-Bis(diphenyphosphino)Pentane?
The Canonical SMILES of 1,5-Bis(diphenyphosphino)Pentane is C1=CC=C(C=C1)P(CCCCCP(C2=CC=CC=C2)C3=CC=CC=C3)C4=CC=CC=C4.
How many rotatable bond counts are there in 1,5-Bis(diphenyphosphino)Pentane?
There are 10 rotatable bond counts in 1,5-Bis(diphenyphosphino)Pentane.
What is the InChIKey of 1,5-Bis(diphenyphosphino)Pentane?
The InChIKey of 1,5-Bis(diphenyphosphino)Pentane is MZFPAWGWFDGCHP-UHFFFAOYSA-N.
What are some synonyms for 1,5-Bis(diphenyphosphino)Pentane?
Some synonyms for 1,5-Bis(diphenyphosphino)Pentane are 1,5-Pentanediylbis(diphenylphosphine), Pentamethylenebis(diphenylphosphine), and 1,5-bis-(diphenylphosphino)pentane.
Does 1,5-Bis(diphenyphosphino)Pentane have any defined atom stereocenter count?
No, 1,5-Bis(diphenyphosphino)Pentane does not have any defined atom stereocenter count.