ligands&coordination complexes / Alfa Chemistry
Banner
Online Inquiry
Verification code

1,5-Bis(diphenyphosphino)Pentane

Catalog Number ACM27721024-1
CAS 27721-02-4
Structure {[CurrentData.Name]}
Synonyms 1,5-Pentanediylbis[Diphenylphosphine]
IUPAC Name 5-diphenylphosphanylpentyl(diphenyl)phosphane
Molecular Weight 440.50
Molecular Formula C29H30P2
InChI MZFPAWGWFDGCHP-UHFFFAOYSA-N
InChI Key InChI=1S/C29H30P2/c1-6-16-26(17-7-1)30(27-18-8-2-9-19-27)24-14-5-15-25-31(28-20-10-3-11-21-28)29-22-12-4-13-23-29/h1-4,6-13,16-23H,5,14-15,24-25H2
Boiling Point 230 °C
Melting Point 43-47 °C(lit.)
Flash Point >230 °F
Purity 98%
Appearance Solid
Isomeric SMILES C1=CC=C(C=C1)P(CCCCCP(C2=CC=CC=C2)C3=CC=CC=C3)C4=CC=CC=C4
Q&A

What is the IUPAC name of 1,5-Bis(diphenyphosphino)Pentane?

The IUPAC name of 1,5-Bis(diphenyphosphino)Pentane is 5-diphenylphosphanylpentyl(diphenyl)phosphane.

What is the molecular formula of 1,5-Bis(diphenyphosphino)Pentane?

The molecular formula of 1,5-Bis(diphenyphosphino)Pentane is C29H30P2.

What is the molecular weight of 1,5-Bis(diphenyphosphino)Pentane?

The molecular weight of 1,5-Bis(diphenyphosphino)Pentane is 440.5g/mol.

How many heavy atoms are present in 1,5-Bis(diphenyphosphino)Pentane?

There are 31 heavy atoms present in 1,5-Bis(diphenyphosphino)Pentane.

What is the exact mass of 1,5-Bis(diphenyphosphino)Pentane?

The exact mass of 1,5-Bis(diphenyphosphino)Pentane is 440.18227495.

What is the Canonical SMILES of 1,5-Bis(diphenyphosphino)Pentane?

The Canonical SMILES of 1,5-Bis(diphenyphosphino)Pentane is C1=CC=C(C=C1)P(CCCCCP(C2=CC=CC=C2)C3=CC=CC=C3)C4=CC=CC=C4.

How many rotatable bond counts are there in 1,5-Bis(diphenyphosphino)Pentane?

There are 10 rotatable bond counts in 1,5-Bis(diphenyphosphino)Pentane.

What is the InChIKey of 1,5-Bis(diphenyphosphino)Pentane?

The InChIKey of 1,5-Bis(diphenyphosphino)Pentane is MZFPAWGWFDGCHP-UHFFFAOYSA-N.

What are some synonyms for 1,5-Bis(diphenyphosphino)Pentane?

Some synonyms for 1,5-Bis(diphenyphosphino)Pentane are 1,5-Pentanediylbis(diphenylphosphine), Pentamethylenebis(diphenylphosphine), and 1,5-bis-(diphenylphosphino)pentane.

Does 1,5-Bis(diphenyphosphino)Pentane have any defined atom stereocenter count?

No, 1,5-Bis(diphenyphosphino)Pentane does not have any defined atom stereocenter count.

Please kindly note that our products and services are for research use only.