What is the CAS number for 1,3-Bis(dicyclohexylphosphino)propane bis(tetrafluoro borate)?
The CAS number is 1002345-50-7.
What is the Canonical SMILES for 1,3-Bis(dicyclohexylphosphino)propane bis(tetrafluoro borate)?
[B-](F)(F)(F)F.[B-](F)(F)(F)F.C1CCC(CC1)[PH+](CCC[PH+](C2CCCCC2)C3CCCCC3)C4CCCCC4
How many covalently-bonded units are present in 1,3-Bis(dicyclohexylphosphino)propane bis(tetrafluoro borate)?
There are 3 covalently-bonded units.
What is the exact mass of 1,3-Bis(dicyclohexylphosphino)propane bis(tetrafluoro borate)?
The exact mass is 612.3602613 g/mol.
What is the IUPAC name of 1,3-Bis(dicyclohexylphosphino)propane bis(tetrafluoro borate)?
The IUPAC name is dicyclohexyl(3-dicyclohexylphosphaniumylpropyl)phosphanium;ditetrafluoroborate.
How many hydrogen bond acceptors are in 1,3-Bis(dicyclohexylphosphino)propane bis(tetrafluoro borate)?
There are 10 hydrogen bond acceptors.
What is the molecular formula of 1,3-Bis(dicyclohexylphosphino)propane bis(tetrafluoro borate)?
The molecular formula is C27H52B2F8P2.
What is the molecular weight of 1,3-Bis(dicyclohexylphosphino)propane bis(tetrafluoro borate)?
The molecular weight is 612.3 g/mol.
What is the Monoisotopic Mass of 1,3-Bis(dicyclohexylphosphino)propane bis(tetrafluoro borate)?
The Monoisotopic Mass is 612.3602613 g/mol.
What are some of the depositor-supplied synonyms for 1,3-Bis(dicyclohexylphosphino)propane bis(tetrafluoro borate)?
Some of the synonyms include Propane-1,3-diylbis(dicyclohexylphosphonium) tetrafluoroborate, AKOS037647518, and CS-W020740.