1,3,5-Tris(5-chloropyridin-3-yl)benzene

Catalog Number	ACM2095298294
CAS	2095298-29-4
Synonyms	3-[3,5-Bis(5-chloropyridin-3-yl)phenyl]-5-chloropyridine
IUPAC Name	3-[3,5-bis(5-chloropyridin-3-yl)phenyl]-5-chloropyridine
Molecular Weight	412.70
Molecular Formula	C21H12Cl3N3
InChI	MDAJREZEJHAADD-UHFFFAOYSA-N
InChI Key	InChI=1S/C21H12Cl3N3/c22-19-4-16(7-25-10-19)13-1-14(17-5-20(23)11-26-8-17)3-15(2-13)18-6-21(24)12-27-9-18/h1-12H
Purity	98%
Isomeric SMILES	C1=C(C=C(C=C1C2=CC(=CN=C2)Cl)C3=CC(=CN=C3)Cl)C4=CC(=CN=C4)Cl

Q&A

What is the CAS number for the compound 1,3,5-Tris(5-chloropyridin-3-yl)benzene?

The CAS number is 2095298-29-4.

What is the molecular weight of 1,3,5-Tris(5-chloropyridin-3-yl)benzene?

The molecular weight is 412.7.

What are some synonyms for 1,3,5-Tris(5-chloropyridin-3-yl)benzene?

Some synonyms include Pyridine, 3,3',3''-(1,3,5-benzenetriyl)tris[5-chloro-.

What is the molecular formula of 1,3,5-Tris(5-chloropyridin-3-yl)benzene?

The molecular formula is C21H12Cl3N3.

What is the predicted boiling point of 1,3,5-Tris(5-chloropyridin-3-yl)benzene?

The predicted boiling point is 563.7±45.0 °C.

What is the predicted pKa value of 1,3,5-Tris(5-chloropyridin-3-yl)benzene?

The predicted pKa value is 2.43±0.22.

What is the predicted density of 1,3,5-Tris(5-chloropyridin-3-yl)benzene?

The predicted density is 1.371±0.06 g/cm3.

How many chloropyridin-3-yl groups are present in 1,3,5-Tris(5-chloropyridin-3-yl)benzene?

There are three chloropyridin-3-yl groups present.

What is the structure of 1,3,5-Tris(5-chloropyridin-3-yl)benzene?

The compound has a benzene ring with three 5-chloropyridin-3-yl groups attached to it.

What are some potential properties or uses of 1,3,5-Tris(5-chloropyridin-3-yl)benzene based on its molecular structure and predicted values?

The compound may have applications in areas such as pharmaceuticals, materials science, or organic synthesis due to its unique structure and predicted properties.