ligands&coordination complexes / Alfa Chemistry
Banner
Online Inquiry
Verification code

1,2-Bis(diphenylphosphino)ethyne

Catalog Number ACM5112958-1
CAS 5112-95-8
Structure {[CurrentData.Name]}
Synonyms Bis(diphenylphosphino)acetylene
IUPAC Name 2-diphenylphosphanylethynyl(diphenyl)phosphane
Molecular Weight 394.38
Molecular Formula C26H20P2
InChI FOWZHJNBFVLJGP-UHFFFAOYSA-N
InChI Key InChI=1S/C26H20P2/c1-5-13-23(14-6-1)27(24-15-7-2-8-16-24)21-22-28(25-17-9-3-10-18-25)26-19-11-4-12-20-26/h1-20H
Boiling Point 529.6±33.0 °C(Predicted)
Melting Point 86-88 °C(lit.)
Purity 98%
Appearance Solid
Isomeric SMILES C1=CC=C(C=C1)P(C#CP(C2=CC=CC=C2)C3=CC=CC=C3)C4=CC=CC=C4
Q&A

What is the CAS number for 1,2-Bis(diphenylphosphino)ethyne?

The CAS number for 1,2-Bis(diphenylphosphino)ethyne is 5112-95-8.

What is the molecular weight of 1,2-Bis(diphenylphosphino)ethyne?

The molecular weight of 1,2-Bis(diphenylphosphino)ethyne is 394.4 g/mol.

How many heavy atoms are present in the molecule?

There are 28 heavy atoms present in the molecule.

What is the Canonical SMILES representation of 1,2-Bis(diphenylphosphino)ethyne?

The Canonical SMILES representation is C1=CC=C(C=C1)P(C#CP(C2=CC=CC=C2)C3=CC=CC=C3)C4=CC=CC=C4.

What is the InChIKey for 1,2-Bis(diphenylphosphino)ethyne?

The InChIKey for 1,2-Bis(diphenylphosphino)ethyne is FOWZHJNBFVLJGP-UHFFFAOYSA-N.

How many hydrogen bond acceptor counts does the molecule have?

The molecule has 0 hydrogen bond acceptor count.

What is the formal charge of 1,2-Bis(diphenylphosphino)ethyne?

The formal charge of 1,2-Bis(diphenylphosphino)ethyne is 0.

Are there any defined atom stereocenters in the molecule?

No, there are no defined atom stereocenters in the molecule.

What is the common name or synonym for 1,2-Bis(diphenylphosphino)ethyne?

A common synonym for 1,2-Bis(diphenylphosphino)ethyne is Bis(diphenylphosphino)acetylene.

Please kindly note that our products and services are for research use only.