[1,2-Bis(diphenylphosphino)ethane]dichloropalladium(II)

Catalog Number	ACM19978611-2
CAS	19978-61-1
Structure
Synonyms	1,2-Bis(diphenylphosphino)ethane palladium(II) chloride
IUPAC Name	dichloropalladium;2-diphenylphosphanylethyl(diphenyl)phosphane;
Molecular Weight	575.74
Molecular Formula	C26H24Cl2P2Pd
Canonical SMILES	C1=CC=C(C=C1)P(CCP(C2=CC=CC=C2)C3=CC=CC=C3)C4=CC=CC=C4.Cl[Pd]Cl
InChI	InChI=1S/C26H24P2.2ClH.Pd/c1-5-13-23(14-6-1)27(24-15-7-2-8-16-24)21-22-28(25-17-9-3-10-18-25)26-19-11-4-12-20-26;/h1-20H,21-22H2;2*1H;/q;+2/p-2
InChI Key	LDJXFZUGZASGIW-UHFFFAOYSA-L
Melting Point	360 °C
Purity	99%
Appearance	White-like powder
Application	suzuki reaction
Complexity	339
Covalently-Bonded Unit Count	2
Defined Atom Stereocenter Count	0
Exact Mass	573.97651
Heavy Atom Count	31
Hydrogen Bond Acceptor Count	0
Hydrogen Bond Donor Count	0
Monoisotopic Mass	573.97651
Rotatable Bond Count	7
Topological Polar Surface Area	0 Ų

Q&A

What is the molecular formula of [1,2-Bis(diphenylphosphino)ethane]dichloropalladium(II)?

The molecular formula is C26H24Cl2P2Pd.

What is the molecular weight of [1,2-Bis(diphenylphosphino)ethane]dichloropalladium(II)?

The molecular weight is 575.7 g/mol.

What are the synonyms for [1,2-Bis(diphenylphosphino)ethane]dichloropalladium(II)?

Some synonyms include PdCl2(dppe) and Dichloro(1,2-bis(diphenylphosphino)ethane)palladium(II).

What is the IUPAC name for [1,2-Bis(diphenylphosphino)ethane]dichloropalladium(II)?

The IUPAC name is dichloropalladium;2-diphenylphosphanylethyl(diphenyl)phosphane.

What is the InChIKey for [1,2-Bis(diphenylphosphino)ethane]dichloropalladium(II)?

The InChIKey is LDJXFZUGZASGIW-UHFFFAOYSA-L.

What is the Canonical SMILES for [1,2-Bis(diphenylphosphino)ethane]dichloropalladium(II)?

The Canonical SMILES is C1=CC=C(C=C1)P(CCP(C2=CC=CC=C2)C3=CC=CC=C3)C4=CC=CC=C4.Cl[Pd]Cl.

What is the CAS number for [1,2-Bis(diphenylphosphino)ethane]dichloropalladium(II)?

The CAS number is 19978-61-1.

How many rotatable bond counts are there in [1,2-Bis(diphenylphosphino)ethane]dichloropalladium(II)?

There are 7 rotatable bond counts.

What is the topological polar surface area for [1,2-Bis(diphenylphosphino)ethane]dichloropalladium(II)?

The topological polar surface area is 0?2.

Is [1,2-Bis(diphenylphosphino)ethane]dichloropalladium(II) a canonicalized compound?

Yes, it is a canonicalized compound.

Can you provide any synonyms for [1,2-Bis(diphenylphosphino)ethane]dichloropalladium(II)?

Some synonyms include PdCl2(dppe) and Dichloro(1,2-bis(diphenylphosphino)ethane)palladium(II).

When was [1,2-Bis(diphenylphosphino)ethane]dichloropalladium(II) created?

It was created on October 26, 2006.

What is the InChIKey of [1,2-Bis(diphenylphosphino)ethane]dichloropalladium(II)?

The InChIKey is LDJXFZUGZASGIW-UHFFFAOYSA-L.

How many hydrogen bond donor counts does [1,2-Bis(diphenylphosphino)ethane]dichloropalladium(II) have?

It has 0 hydrogen bond donor counts.

What is the topological polar surface area of [1,2-Bis(diphenylphosphino)ethane]dichloropalladium(II)?

The topological polar surface area is 0.2.

How many defined atom stereocenter counts does [1,2-Bis(diphenylphosphino)ethane]dichloropalladium(II) have?

It has 0 defined atom stereocenter counts.

What is the exact mass of [1,2-Bis(diphenylphosphino)ethane]dichloropalladium(II)?

The exact mass is 573.97651 g/mol.

How many component compounds are included in [1,2-Bis(diphenylphosphino)ethane]dichloropalladium(II)?

There are two component compounds: Palladium(II) chloride and 1,2-Bis(diphenylphosphino)ethane.