What is the molecular formula of 1,1'-Bis(diphenylphosphino)-9,9'-spirobi[xanthene]?
The molecular formula is C49H34O2P2.
What is the exact mass of 1,1'-Bis(diphenylphosphino)-9,9'-spirobi[xanthene]?
The exact mass is 716.20340432 g/mol.
How many heavy atoms are present in the structure of 1,1'-Bis(diphenylphosphino)-9,9'-spirobi[xanthene]?
There are 53 heavy atoms in the structure.
What is the Canonical SMILES representation of 1,1'-Bis(diphenylphosphino)-9,9'-spirobi[xanthene]?
The Canonical SMILES is C1=CC=C(C=C1)P(C2=CC=CC=C2)C3=CC=CC4=C3C5(C6=CC=CC=C6O4)C7=CC=CC=C7OC8=C5C(=CC=C8)P(C9=CC=CC=C9)C1=CC=CC=C1.
How many rotatable bonds are present in the structure of 1,1'-Bis(diphenylphosphino)-9,9'-spirobi[xanthene]?
There are 6 rotatable bonds in the structure.
What is the XLogP3 value of 1,1'-Bis(diphenylphosphino)-9,9'-spirobi[xanthene]?
The XLogP3 value is 11.6.
What is the IUPAC name of 1,1'-Bis(diphenylphosphino)-9,9'-spirobi[xanthene]?
The IUPAC name is (1'-diphenylphosphanyl-9,9'-spirobi[xanthene]-1-yl)-diphenylphosphane.
How many hydrogen bond acceptors are there in the structure of 1,1'-Bis(diphenylphosphino)-9,9'-spirobi[xanthene]?
There are 2 hydrogen bond acceptors.
What is the Depositor-Supplied Synonym for 1,1'-Bis(diphenylphosphino)-9,9'-spirobi[xanthene]?
The synonym is SCHEMBL13324536.
