ligands&coordination complexes / Alfa Chemistry
Banner
Online Inquiry
Verification code

1,1'-Bis(diphenylphosphino)-9,9'-spirobi[xanthene]

Catalog Number ACM877305823
CAS 877305-82-3
Molecular Weight 716.74
Molecular Formula C49H34O2P2
Purity 98%
Q&A

What is the molecular formula of 1,1'-Bis(diphenylphosphino)-9,9'-spirobi[xanthene]?

The molecular formula is C49H34O2P2.

What is the exact mass of 1,1'-Bis(diphenylphosphino)-9,9'-spirobi[xanthene]?

The exact mass is 716.20340432 g/mol.

How many heavy atoms are present in the structure of 1,1'-Bis(diphenylphosphino)-9,9'-spirobi[xanthene]?

There are 53 heavy atoms in the structure.

What is the Canonical SMILES representation of 1,1'-Bis(diphenylphosphino)-9,9'-spirobi[xanthene]?

The Canonical SMILES is C1=CC=C(C=C1)P(C2=CC=CC=C2)C3=CC=CC4=C3C5(C6=CC=CC=C6O4)C7=CC=CC=C7OC8=C5C(=CC=C8)P(C9=CC=CC=C9)C1=CC=CC=C1.

How many rotatable bonds are present in the structure of 1,1'-Bis(diphenylphosphino)-9,9'-spirobi[xanthene]?

There are 6 rotatable bonds in the structure.

What is the XLogP3 value of 1,1'-Bis(diphenylphosphino)-9,9'-spirobi[xanthene]?

The XLogP3 value is 11.6.

What is the IUPAC name of 1,1'-Bis(diphenylphosphino)-9,9'-spirobi[xanthene]?

The IUPAC name is (1'-diphenylphosphanyl-9,9'-spirobi[xanthene]-1-yl)-diphenylphosphane.

How many hydrogen bond acceptors are there in the structure of 1,1'-Bis(diphenylphosphino)-9,9'-spirobi[xanthene]?

There are 2 hydrogen bond acceptors.

What is the Depositor-Supplied Synonym for 1,1'-Bis(diphenylphosphino)-9,9'-spirobi[xanthene]?

The synonym is SCHEMBL13324536.

Please kindly note that our products and services are for research use only.