ligands&coordination complexes / Alfa Chemistry
Banner
Online Inquiry
Verification code

1,1'-Bis(dichlorophosphino)ferrocene

Catalog Number ACM142691701-1
CAS 142691-70-1
Structure {[CurrentData.Name]}
Synonyms Bis(dichlorophosphino)ferrocene
Molecular Weight 387.78
Molecular Formula C₁₀H₈Cl₄FeP₂
Melting Point 67-71 °C
Purity 98%
Appearance Solid
Application 1,1'-BIS(DICHLOROPHOSPHINO)FERROCENE (cas# 142691-70-1) is a useful research chemical.
Q&A

What is the molecular formula of 1,1'-Bis(dichlorophosphino)ferrocene?

The molecular formula is C10H8Cl4FeP2.

What is the exact mass of 1,1'-Bis(dichlorophosphino)ferrocene?

The exact mass is 387.817520 g/mol.

What are the depositor-supplied synonyms for 1,1'-Bis(dichlorophosphino)ferrocene?

NPMZCAJVVAULRY-UHFFFAOYSA-N, 1,1'-Bis(dichlorophosphino)-Ferrocene, J-007681.

How many covalently-bonded units are there in 1,1'-Bis(dichlorophosphino)ferrocene?

There are 3 covalently-bonded units.

What is the Canonical SMILES for 1,1'-Bis(dichlorophosphino)ferrocene?

[CH-]1C=CC=C1P(Cl)Cl.[CH-]1C=CC=C1P(Cl)Cl.[Fe+2]

How many heavy atoms are present in 1,1'-Bis(dichlorophosphino)ferrocene?

There are 17 heavy atoms.

What is the IUPAC Name of 1,1'-Bis(dichlorophosphino)ferrocene?

Dichloro(cyclopenta-1,3-dien-1-yl)phosphane;iron(2+)

What is the InChIKey for 1,1'-Bis(dichlorophosphino)ferrocene?

NPMZCAJVVAULRY-UHFFFAOYSA-N

How many hydrogen bond acceptors are there in 1,1'-Bis(dichlorophosphino)ferrocene?

There are 2 hydrogen bond acceptors.

What is the Computed Properties Complexity of 1,1'-Bis(dichlorophosphino)ferrocene?

The complexity is 68.8.

Please kindly note that our products and services are for research use only.