Vinyltriphenylphosphonium bromide

Catalog Number	ACM5044520-1
CAS	5044-52-0
Structure
Synonyms	Triphenyl(vinyl)phosphonium bromide; Schweizer's reagent
IUPAC Name	ethenyl(triphenyl)phosphanium;bromide
Molecular Weight	369.24
Molecular Formula	C20H18BrP
Canonical SMILES	C=C[P+](C1=CC=CC=C1)(C2=CC=CC=C2)C3=CC=CC=C3.[Br-]
InChI	VRAYVWUMBAJVGH-UHFFFAOYSA-M
InChI Key	InChI=1S/C20H18P.BrH/c1-2-21(18-12-6-3-7-13-18,19-14-8-4-9-15-19)20-16-10-5-11-17-20;/h2-17H,1H2;1H/q+1;/p-1
Melting Point	176-178 °C(lit.)
Purity	95%+
Appearance	Solid
EC Number	225-740-3
Exact Mass	368.03300
Isomeric SMILES	C=C[P+](C1=CC=CC=C1)(C2=CC=CC=C2)C3=CC=CC=C3.[Br-]

Q&A

What is the CAS number for Vinyltriphenylphosphonium bromide?

The CAS number for Vinyltriphenylphosphonium bromide is 5044-52-0.

What is the molecular formula of Vinyltriphenylphosphonium bromide?

The molecular formula of Vinyltriphenylphosphonium bromide is C20H18BrP.

How many covalently-bonded units are present in Vinyltriphenylphosphonium bromide?

There are 2 covalently-bonded units present in Vinyltriphenylphosphonium bromide.

What is the exact mass of Vinyltriphenylphosphonium bromide?

The exact mass of Vinyltriphenylphosphonium bromide is 368.03295.

How many hydrogen bond acceptors are there in Vinyltriphenylphosphonium bromide?

There is 1 hydrogen bond acceptor in Vinyltriphenylphosphonium bromide.

What is the IUPAC name of Vinyltriphenylphosphonium bromide?

The IUPAC name of Vinyltriphenylphosphonium bromide is ethenyl(triphenyl)phosphanium;bromide.

What is the InChIKey of Vinyltriphenylphosphonium bromide?

The InChIKey of Vinyltriphenylphosphonium bromide is VRAYVWUMBAJVGH-UHFFFAOYSA-M.

How many rotatable bonds are there in Vinyltriphenylphosphonium bromide?

There are 4 rotatable bonds in Vinyltriphenylphosphonium bromide.

What is the topological polar surface area of Vinyltriphenylphosphonium bromide?

The topological polar surface area of Vinyltriphenylphosphonium bromide is 0.

What are some of the synonyms for Vinyltriphenylphosphonium bromide?

Some synonyms for Vinyltriphenylphosphonium bromide include Triphenyl(vinyl)phosphonium bromide, NSC 84065, and Triphenylvinylphosphonium bromide.