What is the CAS number for Tris(p-tert-butylphenyl)phosphineoxide?
The CAS number for Tris(p-tert-butylphenyl)phosphineoxide is 29942-35-6.
What is the molecular weight of Tris(p-tert-butylphenyl)phosphineoxide?
The molecular weight of Tris(p-tert-butylphenyl)phosphineoxide is 446.6g/mol.
How many heavy atoms are present in the chemical structure of Tris(p-tert-butylphenyl)phosphineoxide?
There are 32 heavy atoms in the chemical structure of Tris(p-tert-butylphenyl)phosphineoxide.
What is the Canonical SMILES representation of Tris(p-tert-butylphenyl)phosphineoxide?
The Canonical SMILES representation is CC(C)(C)C1=CC=C(C=C1)P(=O)(C2=CC=C(C=C2)C(C)(C)C)C3=CC=C(C=C3)C(C)(C)C.
How many rotatable bonds are present in the structure of Tris(p-tert-butylphenyl)phosphineoxide?
There are 6 rotatable bonds in the structure of Tris(p-tert-butylphenyl)phosphineoxide.
What is the InChIKey for Tris(p-tert-butylphenyl)phosphineoxide?
The InChIKey is PNWKMUUTDFAROK-UHFFFAOYSA-N.
What is the Monoisotopic Mass of Tris(p-tert-butylphenyl)phosphineoxide?
The Monoisotopic Mass is 446.27385286.
How many hydrogen bond acceptors are present in Tris(p-tert-butylphenyl)phosphineoxide?
There is 1 hydrogen bond acceptor in Tris(p-tert-butylphenyl)phosphineoxide.
What is the IUPAC Name of Tris(p-tert-butylphenyl)phosphineoxide?
The IUPAC Name is 1-bis(4-tert-butylphenyl)phosphoryl-4-tert-butylbenzene.
What are some of the other synonyms for Tris(p-tert-butylphenyl)phosphineoxide?
Some other synonyms include Tris(4-tert-butylphenyl)phosphine oxide, Tris-(4-tert-butylphenyl)-phosphine oxide, and Tris(4-tert-butylphenyl)(oxo)-lambda~5~-phosphane.