ligands&coordination complexes / Alfa Chemistry
Banner
Online Inquiry
Verification code

Tris-(morpholino)-phosphine oxide

Catalog Number ACM4441127-1
CAS 4441-12-7
Structure {[CurrentData.Name]}
Synonyms 4,4',4''-Phosphoryltrimorpholine; Tri(4-morpholinyl)phosphine oxide; 4-Dimorpholin-4-ylphosphorylmorpholine
IUPAC Name 4-dimorpholin-4-ylphosphorylmorpholine
Molecular Weight 305.31
Molecular Formula C12H24N3O4P
InChI WXMQHPKQCPCDQO-UHFFFAOYSA-N
InChI Key InChI=1S/C12H24N3O4P/c16-20(13-1-7-17-8-2-13,14-3-9-18-10-4-14)15-5-11-19-12-6-15/h1-12H2
Boiling Point 476.4±45.0 °C(Predicted)
Melting Point 188-190 °C
Purity 98%+
Appearance Solid
Isomeric SMILES C1COCCN1P(=O)(N2CCOCC2)N3CCOCC3
pKa 1.61±0.20(Predicted)
Q&A

What is the CAS number for Tris-(morpholino)-phosphine oxide?

The CAS number for Tris-(morpholino)-phosphine oxide is 4441-12-7.

What is the molecular formula of Tris-(morpholino)-phosphine oxide?

The molecular formula of Tris-(morpholino)-phosphine oxide is C12H24N3O4P.

How many heavy atoms are present in Tris-(morpholino)-phosphine oxide?

There are 20 heavy atoms present in Tris-(morpholino)-phosphine oxide.

What is the IUPAC name of Tris-(morpholino)-phosphine oxide?

The IUPAC name of Tris-(morpholino)-phosphine oxide is 4-dimorpholin-4-ylphosphorylmorpholine.

What is the XLogP3 value of Tris-(morpholino)-phosphine oxide?

The XLogP3 value of Tris-(morpholino)-phosphine oxide is -1.1.

How many hydrogen bond acceptor counts are there in Tris-(morpholino)-phosphine oxide?

There are 7 hydrogen bond acceptor counts in Tris-(morpholino)-phosphine oxide.

What is the computed properties complexity of Tris-(morpholino)-phosphine oxide?

The computed properties complexity of Tris-(morpholino)-phosphine oxide is 300.

What is the canonical SMILES representation of Tris-(morpholino)-phosphine oxide?

The canonical SMILES representation of Tris-(morpholino)-phosphine oxide is C1COCCN1P(=O)(N2CCOCC2)N3CCOCC3.

What is the monoisotopic mass of Tris-(morpholino)-phosphine oxide?

The monoisotopic mass of Tris-(morpholino)-phosphine oxide is 305.15044325.

What are some of the depositor-supplied synonyms for Tris-(morpholino)-phosphine oxide?

Some of the depositor-supplied synonyms for Tris-(morpholino)-phosphine oxide include Trimorpholinophosphine oxide, Phosphoric Trimorpholide, and Tri(4-morpholinyl)phosphine oxide.

Please kindly note that our products and services are for research use only.