Tris(4-fluorophenyl)phosphine

Catalog Number	ACM18437780-2
CAS	18437-78-0
Structure
Synonyms	Phosphine, Tris(4-Fluorophenyl)-
IUPAC Name	tris(4-fluorophenyl)phosphane;
Molecular Weight	316.26
Molecular Formula	C18H12F3P
Canonical SMILES	C1=CC(=CC=C1F)P(C2=CC=C(C=C2)F)C3=CC=C(C=C3)F;
InChI	InChI=1S/C18H12F3P/c19-13-1-7-16(8-2-13)22(17-9-3-14(20)4-10-17)18-11-5-15(21)6-12-18/h1-12H;
InChI Key	GEPJPYNDFSOARB-UHFFFAOYSA-N;
Purity	97%
Appearance	Grey white solid
Complexity	275
Covalently-Bonded Unit Count	1
Exact Mass	316.063g/mol
Heavy Atom Count	22
Monoisotopic Mass	316.063g/mol
Rotatable Bond Count	3
Topological Polar Surface Area	0A^2

Q&A

What is the molecular formula of Tris(4-fluorophenyl)phosphine?

The molecular formula of Tris(4-fluorophenyl)phosphine is C18H12F3P.

When was Tris(4-fluorophenyl)phosphine created in PubChem?

Tris(4-fluorophenyl)phosphine was created in PubChem on March 26, 2005.

What is the molecular weight of Tris(4-fluorophenyl)phosphine?

The molecular weight of Tris(4-fluorophenyl)phosphine is 316.3 g/mol.

What is the InChIKey of Tris(4-fluorophenyl)phosphine?

The InChIKey of Tris(4-fluorophenyl)phosphine is GEPJPYNDFSOARB-UHFFFAOYSA-N.

How many hydrogen bond acceptors does Tris(4-fluorophenyl)phosphine have?

Tris(4-fluorophenyl)phosphine has 3 hydrogen bond acceptors.

What is the topological polar surface area of Tris(4-fluorophenyl)phosphine?

The topological polar surface area of Tris(4-fluorophenyl)phosphine is 0-2.

How many rotatable bonds does Tris(4-fluorophenyl)phosphine have?

Tris(4-fluorophenyl)phosphine has 3 rotatable bonds.

Is Tris(4-fluorophenyl)phosphine considered to be a canonical compound?

Yes, Tris(4-fluorophenyl)phosphine is considered to be a canonical compound.

What is the XLogP3-AA value of Tris(4-fluorophenyl)phosphine?

The XLogP3-AA value of Tris(4-fluorophenyl)phosphine is 4.9.

How many heavy atoms are present in a molecule of Tris(4-fluorophenyl)phosphine?

There are 22 heavy atoms present in a molecule of Tris(4-fluorophenyl)phosphine.