What is the CAS number for tris(3-methoxypropyl)phosphine?
The CAS number for tris(3-methoxypropyl)phosphine is 83622-85-9.
What is the Canonical SMILES representation of tris(3-methoxypropyl)phosphine?
The Canonical SMILES representation is COCCCP(CCCOC)CCCOC.
How many heavy atoms are present in tris(3-methoxypropyl)phosphine?
There are 16 heavy atoms in tris(3-methoxypropyl)phosphine.
What is the computed topological polar surface area of tris(3-methoxypropyl)phosphine?
The computed topological polar surface area is 27.7.
What is the molecular weight of tris(3-methoxypropyl)phosphine?
The molecular weight of tris(3-methoxypropyl)phosphine is 250.31 g/mol.
What is the IUPAC name for tris(3-methoxypropyl)phosphine?
The IUPAC name is tris(3-methoxypropyl)phosphane.
What is the InChI representation of tris(3-methoxypropyl)phosphine?
The InChI representation is InChI=1S/C12H27O3P/c1-13-7-4-10-16(11-5-8-14-2)12-6-9-15-3/h4-12H2,1-3H3.
What is the molecular formula of tris(3-methoxypropyl)phosphine?
The molecular formula is C12H27O3P.
What is the exact mass of tris(3-methoxypropyl)phosphine?
The exact mass is 250.16978172.
What are some of the synonyms for tris(3-methoxypropyl)phosphine?
Some synonyms include Trifosmin, tris(3-methoxypropyl)phosphane, and Phosphine, tris(3-methoxypropyl)-.