Tris(3,5-dimethylphenyl)phosphine

Catalog Number	ACM69227470-1
CAS	69227-47-0
Structure
Synonyms	Tri-3,5-xylylphosphine; Phosphine,tris(3,5-Dimethylphenyl)-
IUPAC Name	tris(3,5-dimethylphenyl)phosphane
Molecular Weight	346.45
Molecular Formula	C24H27P
InChI	XRALRSQLQXKXKP-UHFFFAOYSA-N
InChI Key	InChI=1S/C24H27P/c1-16-7-17(2)11-22(10-16)25(23-12-18(3)8-19(4)13-23)24-14-20(5)9-21(6)15-24/h7-15H,1-6H3
Boiling Point	474.1±45.0 °C(Predicted)
Melting Point	160-165 °C
Purity	98%
Appearance	Solid
Isomeric SMILES	CC1=CC(=CC(=C1)P(C2=CC(=CC(=C2)C)C)C3=CC(=CC(=C3)C)C)C

Q&A

What is the IUPAC name of Tris(3,5-dimethylphenyl)phosphine with the CAS number 69227-47-0?

The IUPAC name is tris(3,5-dimethylphenyl)phosphane.

What is the molecular formula of Tris(3,5-dimethylphenyl)phosphine?

The molecular formula is C24H27P.

How many heavy atoms are present in Tris(3,5-dimethylphenyl)phosphine?

There are 25 heavy atoms.

What is the exact mass of Tris(3,5-dimethylphenyl)phosphine?

The exact mass is 346.185037859.

What is the EC number for Tris(3,5-dimethylphenyl)phosphine?

The European Community (EC) Number is 624-162-2.

How many rotatable bonds are present in Tris(3,5-dimethylphenyl)phosphine?

There are 3 rotatable bonds.

What is the Canonical SMILES of Tris(3,5-dimethylphenyl)phosphine?

The Canonical SMILES is CC1=CC(=CC(=C1)P(C2=CC(=CC(=C2)C)C)C3=CC(=CC(=C3)C)C)C.

What is the XLogP3 value for Tris(3,5-dimethylphenyl)phosphine?

The XLogP3 value is 6.8.

What are some Depositor-Supplied Synonyms for Tris(3,5-dimethylphenyl)phosphine?

Some Depositor-Supplied Synonyms are Tri-3,5-xylylphosphine, Phosphine, tris(3,5-dimethylphenyl)-, and tris(3,5-xylyl) phosphine.