What is the molecular formula of Tris(2-(diphenylphosphino)phenyl)phosphine?
The molecular formula is C54H42P4.
What is the exact mass of Tris(2-(diphenylphosphino)phenyl)phosphine?
The exact mass is 814.22369933.
What is the IUPAC name of Tris(2-(diphenylphosphino)phenyl)phosphine?
The IUPAC name is tris(2-diphenylphosphanylphenyl)phosphane.
How many rotatable bonds are there in Tris(2-(diphenylphosphino)phenyl)phosphine?
There are 12 rotatable bonds.
What is the XLogP3 value of Tris(2-(diphenylphosphino)phenyl)phosphine?
The XLogP3 value is 12.7.
What is the canonical SMILES of Tris(2-(diphenylphosphino)phenyl)phosphine?
C1=CC=C(C=C1)P(C2=CC=CC=C2)C3=CC=CC=C3P(C4=CC=CC=C4P(C5=CC=CC=C5)C6=CC=CC=C6)C7=CC=CC=C7P(C8=CC=CC=C8)C9=CC=CC=C9
How many heavy atoms are present in Tris(2-(diphenylphosphino)phenyl)phosphine?
There are 58 heavy atoms.
What is the hydrogen bond acceptor count of Tris(2-(diphenylphosphino)phenyl)phosphine?
The hydrogen bond acceptor count is 0.
What is the hydrogen bond donor count of Tris(2-(diphenylphosphino)phenyl)phosphine?
The hydrogen bond donor count is 0.
What is the depositor-supplied synonym of Tris(2-(diphenylphosphino)phenyl)phosphine?
The depositor-supplied synonym is Tris[2-(diphenylphosphino)phenyl]phosphine.