Tris[2-(dimethylamino)ethyl]amine

Catalog Number	ACM33527912-2
CAS	33527-91-2
Structure
Description	Tris[2-(dimethylamino)ethyl]amine (Me6TREN) is an aliphatic tertiary amine that forms a quadridentate ligand. It is majorly used in atom transfer radical polymerization (ATRP). It is a hexamethyl derivative of (2-aminoethyl)amine, also known as trenMe. It can be prepared by a modification of Ristempart's synthesis.
Synonyms	N1,N1-Bis(2-(dimethylamino)ethyl)-N2,N2-dimethylethane-1,2-diamine
IUPAC Name	N',N'-bis[2-(dimethylamino)ethyl]-N,N-dimethylethane-1,2-diamine
Molecular Weight	230.39
Molecular Formula	C12H30N4
Canonical SMILES	CN(C)CCN(CCN(C)C)CCN(C)C
InChI	VMGSQCIDWAUGLQ-UHFFFAOYSA-N
InChI Key	InChI=1S/C12H30N4/c1-13(2)7-10-16(11-8-14(3)4)12-9-15(5)6/h7-12H2,1-6H3
Boiling Point	243.5 °C at 760 mmHg
Purity	99%+
Density	0.862 g/mL at 25 °C
Appearance	Liquid
Application	Me6TREN forms a complex with copper compounds which can potentially be used as ligands in metalloenzyme redox reactions. Atom Transfer Radical Polymerization (ATRP) ligand for the creation of telechelic polymers.
Exact Mass	230.24704697
Heavy Atom Count	16
Hydrogen Bond Acceptor Count	4
Hydrogen Bond Donor Count	0
MDL Number	MFCD00015607
Monoisotopic Mass	230.24704697
PubChem ID	329763980
Rotatable Bond Count	9
Topological Polar Surface Area	13 Ų

Q&A

What is the IUPAC name of Tris[2-(dimethylamino)ethyl]amine?

The IUPAC name of Tris[2-(dimethylamino)ethyl]amine is N',N'-bis[2-(dimethylamino)ethyl]-N,N-dimethylethane-1,2-diamine.

What is the molecular formula of Tris[2-(dimethylamino)ethyl]amine?

The molecular formula of Tris[2-(dimethylamino)ethyl]amine is C12H30N4.

What is the molecular weight of Tris[2-(dimethylamino)ethyl]amine?

The molecular weight of Tris[2-(dimethylamino)ethyl]amine is 230.39.

What is one of the major uses of Tris[2-(dimethylamino)ethyl]amine?

Tris[2-(dimethylamino)ethyl]amine is majorly used in atom transfer radical polymerization (ATRP).

How can Tris[2-(dimethylamino)ethyl]amine be prepared?

Tris[2-(dimethylamino)ethyl]amine can be prepared by a modification of Ristempart's synthesis.

What is the appearance of Tris[2-(dimethylamino)ethyl]amine?

Tris[2-(dimethylamino)ethyl]amine appears as a liquid.

What is the boiling point of Tris[2-(dimethylamino)ethyl]amine?

The boiling point of Tris[2-(dimethylamino)ethyl]amine is 243.5 °C at 760 mmHg.

What are some features and benefits of Tris[2-(dimethylamino)ethyl]amine?

Some features and benefits include high quality products, fast delivery, and the ability to order additional products.

What is one of the applications of Tris[2-(dimethylamino)ethyl]amine?

Tris[2-(dimethylamino)ethyl]amine forms a complex with copper compounds which can potentially be used as ligands in metalloenzyme redox reactions.

What is the purity level of Tris[2-(dimethylamino)ethyl]amine?

The purity level of Tris[2-(dimethylamino)ethyl]amine is 97%.