What is the CAS number of Tris(2-carboxaldehyde)triphenylphosphine?
The CAS number of Tris(2-carboxaldehyde)triphenylphosphine is 50777-83-8.
What is the molecular formula of Tris(2-carboxaldehyde)triphenylphosphine?
The molecular formula of Tris(2-carboxaldehyde)triphenylphosphine is C21H15O3P.
What is the exact mass of Tris(2-carboxaldehyde)triphenylphosphine?
The exact mass of Tris(2-carboxaldehyde)triphenylphosphine is 346.07588133.
How many heavy atoms are there in Tris(2-carboxaldehyde)triphenylphosphine?
There are 25 heavy atoms in Tris(2-carboxaldehyde)triphenylphosphine.
How many hydrogen bond acceptors does Tris(2-carboxaldehyde)triphenylphosphine have?
Tris(2-carboxaldehyde)triphenylphosphine has 3 hydrogen bond acceptors.
What is the Canonical SMILES representation of Tris(2-carboxaldehyde)triphenylphosphine?
The Canonical SMILES representation of Tris(2-carboxaldehyde)triphenylphosphine is C1=CC=C(C(=C1)C=O)P(C2=CC=CC=C2C=O)C3=CC=CC=C3C=O.
What is the IUPAC name of Tris(2-carboxaldehyde)triphenylphosphine?
The IUPAC name of Tris(2-carboxaldehyde)triphenylphosphine is 2-bis(2-formylphenyl)phosphanylbenzaldehyde.
How many rotatable bonds are present in the structure of Tris(2-carboxaldehyde)triphenylphosphine?
There are 6 rotatable bonds in the structure of Tris(2-carboxaldehyde)triphenylphosphine.
What is the topological polar surface area of Tris(2-carboxaldehyde)triphenylphosphine?
The topological polar surface area of Tris(2-carboxaldehyde)triphenylphosphine is 51.2.
What is the InChIKey for Tris(2-carboxaldehyde)triphenylphosphine?
The InChIKey for Tris(2-carboxaldehyde)triphenylphosphine is UYVNSMJGMCPGFL-UHFFFAOYSA-N.