Tris(2,4-dimethylphenyl)phosphine

Catalog Number	ACM49676428-1
CAS	49676-42-8
Structure
Synonyms	Tri-2,4-xylylphosphine; Tris(2,4-dimethylphenyl)phosphane
IUPAC Name	tris(2,4-dimethylphenyl)phosphane
Molecular Weight	346.45
Molecular Formula	C24H27P
InChI	XDHRVAHAGMMFMC-UHFFFAOYSA-N
InChI Key	InChI=1S/C24H27P/c1-16-7-10-22(19(4)13-16)25(23-11-8-17(2)14-20(23)5)24-12-9-18(3)15-21(24)6/h7-15H,1-6H3
Boiling Point	447.6±45.0 °C(Predicted)
Melting Point	157-158 °C
Purity	98%
Appearance	Solid
Isomeric SMILES	CC1=CC(=C(C=C1)P(C2=C(C=C(C=C2)C)C)C3=C(C=C(C=C3)C)C)C

Q&A

What is the chemical structure of Latanoprost?

The chemical structure of Latanoprost is Tris(2,4-dimethylphenyl)phosphine.

What is the Canonical SMILES representation of Latanoprost?

The Canonical SMILES representation of Latanoprost is CC(C)OC(=O)CCCC=CCC1C(CC(C1CCC(CCC2=CC=CC=C2)O)O)O.

What is the IUPAC Name of Latanoprost?

The IUPAC Name of Latanoprost is propan-2-yl (Z)-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(3R)-3-hydroxy-5-phenylpentyl]cyclopentyl]hept-5-enoate.

What is the Molecular Formula of Latanoprost?

The Molecular Formula of Latanoprost is C26H40O5.

What is the Molecular Weight of Latanoprost?

The Molecular Weight of Latanoprost is 432.6g/mol.

What is the CAS number of Latanoprost?

The CAS numbers of Latanoprost are 155551-81-8 and 130209-82-4.

How many Heavy Atoms are present in the Latanoprost molecule?

There are 31 Heavy Atoms present in the Latanoprost molecule.

How many Rotatable Bonds are present in the Latanoprost molecule?

There are 14 Rotatable Bonds present in the Latanoprost molecule.

How many Defined Atom Stereocenters are present in the Latanoprost molecule?

There are 5 Defined Atom Stereocenters present in the Latanoprost molecule.

What are some of the Depositor-Supplied Synonyms of Latanoprost?

Some of the Depositor-Supplied Synonyms of Latanoprost are Xalatan, PhXA41, latanoprostum, XELPROS, LATANOPROST [WHO-DD], etc.