Tris(2,4-di-t-butylphenyl)phosphite

Catalog Number	ACM31570044-1
CAS	31570-04-4
Structure
Synonyms	Plastic additive 12
IUPAC Name	tris(2,4-ditert-butylphenyl) phosphite
Molecular Weight	646.93
Molecular Formula	C42H63O3P
InChI	JKIJEFPNVSHHEI-UHFFFAOYSA-N
InChI Key	InChI=1S/C42H63O3P/c1-37(2,3)28-19-22-34(31(25-28)40(10,11)12)43-46(44-35-23-20-29(38(4,5)6)26-32(35)41(13,14)15)45-36-24-21-30(39(7,8)9)27-33(36)42(16,17)18/h19-27H,1-18H3
Boiling Point	594.2±50.0 °C(Predicted)
Melting Point	181-184 °C(lit.)
Flash Point	46 °C (115 °F)
Appearance	Solid
Isomeric SMILES	CC(C)(C)C1=CC(=C(C=C1)OP(OC2=C(C=C(C=C2)C(C)(C)C)C(C)(C)C)OC3=C(C=C(C=C3)C(C)(C)C)C(C)(C)C)C(C)(C)C

Q&A

What is the CAS number of Tris(2,4-di-t-butylphenyl)phosphite?

The CAS number of Tris(2,4-di-t-butylphenyl)phosphite is 31570-04-4.

What is the molecular formula of Tris(2,4-di-t-butylphenyl)phosphite?

The molecular formula of Tris(2,4-di-t-butylphenyl)phosphite is C42H63O3P.

What is the molecular weight of Tris(2,4-di-t-butylphenyl)phosphite?

The molecular weight of Tris(2,4-di-t-butylphenyl)phosphite is 646.9g/mol.

What are some synonyms for Tris(2,4-di-t-butylphenyl)phosphite?

Some synonyms for Tris(2,4-di-t-butylphenyl)phosphite include Irgafos 168, Antioxidant 168, and Tris-(2,4-di-t-butylphenyl)phosphite.

How many heavy atoms are present in the chemical structure of Tris(2,4-di-t-butylphenyl)phosphite?

There are 46 heavy atoms in the chemical structure of Tris(2,4-di-t-butylphenyl)phosphite.

What is the XLogP3 value of Tris(2,4-di-t-butylphenyl)phosphite?

The XLogP3 value of Tris(2,4-di-t-butylphenyl)phosphite is 15.5.

How many hydrogen bond acceptors are present in Tris(2,4-di-t-butylphenyl)phosphite?

There are 3 hydrogen bond acceptors in Tris(2,4-di-t-butylphenyl)phosphite.

What is the InChIKey of Tris(2,4-di-t-butylphenyl)phosphite?

The InChIKey of Tris(2,4-di-t-butylphenyl)phosphite is JKIJEFPNVSHHEI-UHFFFAOYSA-N.

What is the Monoisotopic Mass of Tris(2,4-di-t-butylphenyl)phosphite?

The Monoisotopic Mass of Tris(2,4-di-t-butylphenyl)phosphite is 646.45148287.

What is the IUPAC Name of Tris(2,4-di-t-butylphenyl)phosphite?

The IUPAC Name of Tris(2,4-di-t-butylphenyl)phosphite is tris(2,4-ditert-butylphenyl) phosphite.