Tris((1H-benzo[d][1,2,3]triazol-1-yl)methyl)amine

Catalog Number	ACM121238822
CAS	121238-82-2
Synonyms	Tris(1H-1,2,3-Benzotriazol-1-Ylmethyl)Amine; 1-(Benzotriazol-1-yl)-N,N-bis(benzotriazol-1-ylmethyl)methanamine
IUPAC Name	1-(benzotriazol-1-yl)-N,N-bis(benzotriazol-1-ylmethyl)methanamine
Molecular Weight	410.43
Molecular Formula	C21H18N10
InChI	CGTJPXSHORTCPU-UHFFFAOYSA-N
InChI Key	InChI=1S/C21H18N10/c1-4-10-19-16(7-1)22-25-29(19)13-28(14-30-20-11-5-2-8-17(20)23-26-30)15-31-21-12-6-3-9-18(21)24-27-31/h1-12H,13-15H2
Boiling Point	694.6±50.0 °C(Predicted)
Melting Point	180-182 °C
Purity	97%
Isomeric SMILES	C1=CC=C2C(=C1)N=NN2CN(CN3C4=CC=CC=C4N=N3)CN5C6=CC=CC=C6N=N5

Q&A

What is the chemical name of Tris((1H-benzo[d][1,2,3]triazol-1-yl)methyl)amine CAS:121238-82-2?

The chemical name is Tris((1H-benzo[d][1,2,3]triazol-1-yl)methyl)amine.

What is the molecular weight of Tris((1H-benzo[d][1,2,3]triazol-1-yl)methyl)amine?

The molecular weight is 410.43.

What are the synonyms for Tris((1H-benzo[d][1,2,3]triazol-1-yl)methyl)amine?

The synonyms are 1H-Benzotriazole-1-methanamine and N,N-bis(1H-benzotriazol-1-ylmethyl)-.

What is the molecular formula of Tris((1H-benzo[d][1,2,3]triazol-1-yl)methyl)amine?

The molecular formula is C21H18N10.

What is the melting point of Tris((1H-benzo[d][1,2,3]triazol-1-yl)methyl)amine and in what solvent is it measured?

The melting point is 180-182 °C, measured in ethanol (64-17-5).

What is the density of Tris((1H-benzo[d][1,2,3]triazol-1-yl)methyl)amine and how is it predicted?

The density is predicted to be 1.51±0.1 g/cm3.

What is the boiling point of Tris((1H-benzo[d][1,2,3]triazol-1-yl)methyl)amine and how is it predicted?

The boiling point is predicted to be 694.6±50.0 °C.

What is the pKa value of Tris((1H-benzo[d][1,2,3]triazol-1-yl)methyl)amine and how is it predicted?

The pKa value is predicted to be 2.44±0.30.

How many nitrogen atoms are present in Tris((1H-benzo[d][1,2,3]triazol-1-yl)methyl)amine molecule?

There are 10 nitrogen atoms present in the molecule.