Tricyclohexyl phosphine

Catalog Number	ACM2622142-1
CAS	2622-14-2
Structure
Synonyms	Tricyclohexylphosphane; Phosphine,Tricyclohexyl-
IUPAC Name	tricyclohexylphosphane
Molecular Weight	280.43
Molecular Formula	C18H33P
InChI	WLPUWLXVBWGYMZ-UHFFFAOYSA-N
InChI Key	InChI=1S/C18H33P/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18/h16-18H,1-15H2
Boiling Point	110 °C
Melting Point	81-83 °C(lit.)
Flash Point	48 °F
Purity	98%
Density	0.909 g/mL at 25 °C
Appearance	Solid
Isomeric SMILES	C1CCC(CC1)P(C2CCCCC2)C3CCCCC3

Q&A

What is the IUPAC name of Tricyclohexyl phosphine?

The IUPAC name is tricyclohexylphosphane.

What is the molecular formula of tricyclohexylphosphine?

The molecular formula is C18H33P.

What is the exact mass of tricyclohexylphosphine?

The exact mass is 280.231988050.

What is the CAS number of tricyclohexylphosphine?

The CAS number is 2622-14-2.

How many heavy atoms are present in tricyclohexylphosphine?

There are 19 heavy atoms present.

What is the Canonical SMILES representation of tricyclohexylphosphine?

C1CCC(CC1)P(C2CCCCC2)C3CCCCC3

How many rotatable bonds are present in tricyclohexylphosphine?

There are 3 rotatable bonds present.

What are some of the synonyms for tricyclohexylphosphine?

Some synonyms include PCy3, tris(cyclohexyl)phosphine, and P(Cy)3.

What is the XLogP3 value of tricyclohexylphosphine?

The XLogP3 value is 5.4.