What is the InChIKey of Tributylmethylphosphoniummethylsulfate?
The InChIKey of Tributylmethylphosphoniummethylsulfate is JMXOUHNHEFFQIW-UHFFFAOYSA-M
What is the CAS number for Tributylmethylphosphoniummethylsulfate?
The CAS number for Tributylmethylphosphoniummethylsulfate is 69056-62-8
What is the Canonical SMILES of Tributylmethylphosphoniummethylsulfate?
The Canonical SMILES of Tributylmethylphosphoniummethylsulfate is CCCC[P+](C)(CCCC)CCCC.COS(=O)(=O)[O-]
What is the molecular formula of Tributylmethylphosphoniummethylsulfate?
The molecular formula of Tributylmethylphosphoniummethylsulfate is C14H33O4PS
What is the molecular weight of Tributylmethylphosphoniummethylsulfate?
The molecular weight of Tributylmethylphosphoniummethylsulfate is 328.45g/mol
How many heavy atoms are there in Tributylmethylphosphoniummethylsulfate?
There are 20 heavy atoms in Tributylmethylphosphoniummethylsulfate
Does Tributylmethylphosphoniummethylsulfate have any hydrogen bond donor?
No, Tributylmethylphosphoniummethylsulfate does not have any hydrogen bond donor
How many rotatable bonds are there in Tributylmethylphosphoniummethylsulfate?
There are 9 rotatable bonds in Tributylmethylphosphoniummethylsulfate
What is the IUPAC Name of Tributylmethylphosphoniummethylsulfate?
The IUPAC Name of Tributylmethylphosphoniummethylsulfate is methyl sulfate;tributyl(methyl)phosphanium