What is the chemical structure of Tri-tert-butylphosphonium Tetraphenylborate?
The chemical structure of Tri-tert-butylphosphonium Tetraphenylborate is [B-](C1=CC=CC=C1)(C2=CC=CC=C2)(C3=CC=CC=C3)C4=CC=CC=C4.CC(C)(C)[PH+](C(C)(C)C)C(C)(C)C.
What is the CAS number of Tri-tert-butylphosphonium Tetraphenylborate?
The CAS number of Tri-tert-butylphosphonium Tetraphenylborate is 131322-08-2.
How many covalently-bonded units are counted in the computed properties of Tri-tert-butylphosphonium Tetraphenylborate?
Two covalently-bonded units are counted in the computed properties of Tri-tert-butylphosphonium Tetraphenylborate.
How many rotatable bonds are present in Tri-tert-butylphosphonium Tetraphenylborate?
There are seven rotatable bonds present in Tri-tert-butylphosphonium Tetraphenylborate.
What is the molecular weight of Tri-tert-butylphosphonium Tetraphenylborate?
The molecular weight of Tri-tert-butylphosphonium Tetraphenylborate is 522.6 g/mol.
What is the exact mass of Tri-tert-butylphosphonium Tetraphenylborate?
The exact mass of Tri-tert-butylphosphonium Tetraphenylborate is 522.3586687.
What is the IUPAC name of Tri-tert-butylphosphonium Tetraphenylborate?
The IUPAC name of Tri-tert-butylphosphonium Tetraphenylborate is tetraphenylboranuide;tritert-butylphosphanium.
What is the InChI key of Tri-tert-butylphosphonium Tetraphenylborate?
The InChI key of Tri-tert-butylphosphonium Tetraphenylborate is QWISVPBFGJWCBS-UHFFFAOYSA-O.
How many hydrogen bond acceptors are present in Tri-tert-butylphosphonium Tetraphenylborate?
There is one hydrogen bond acceptor present in Tri-tert-butylphosphonium Tetraphenylborate.
What are some of the synonyms of Tri-tert-butylphosphonium Tetraphenylborate?
Some synonyms of Tri-tert-butylphosphonium Tetraphenylborate include tetraphenylboranuide;tritert-butylphosphanium, tri-t-butylphosphonium tetraphenylborate, and Tri-tert-butylphosphanium tetraphenylborate(1-).