Tri-o-tolylphosphine

Catalog Number	ACM6163582-1
CAS	6163-58-2
Structure
Synonyms	Tris(2-Methylphenyl)Phosphine;Tris(2-Methylphenyl)-Phosphin
IUPAC Name	tris(2-methylphenyl)phosphane
Molecular Weight	304.36
Molecular Formula	C21H21P
InChI	COIOYMYWGDAQPM-UHFFFAOYSA-N
InChI Key	InChI=1S/C21H21P/c1-16-10-4-7-13-19(16)22(20-14-8-5-11-17(20)2)21-15-9-6-12-18(21)3/h4-15H,1-3H3
Boiling Point	412.4±44.0 °C(Predicted)
Melting Point	123-125 °C(lit.)
Flash Point	198 °C (388 °F)
Purity	98%
Appearance	Solid
Isomeric SMILES	CC1=CC=CC=C1P(C2=CC=CC=C2C)C3=CC=CC=C3C

Q&A

What is the chemical structure of Tri-o-tolylphosphine?

The chemical structure of Tri-o-tolylphosphine is CC1=CC=CC=C1P(C2=CC=CC=C2C)C3=CC=CC=C3C.

What is the CAS number of Tri-o-tolylphosphine?

The CAS number of Tri-o-tolylphosphine is 6163-58-2.

What is the molecular formula of Tri-o-tolylphosphine?

The molecular formula of Tri-o-tolylphosphine is C21H21P.

What is the molecular weight of Tri-o-tolylphosphine?

The molecular weight of Tri-o-tolylphosphine is 304.4g/mol.

How many covalently-bonded units are present in Tri-o-tolylphosphine?

There is 1 covalently-bonded unit present in Tri-o-tolylphosphine.

What is the XLogP3 value of Tri-o-tolylphosphine?

The XLogP3 value of Tri-o-tolylphosphine is 5.7.

How many rotatable bonds are present in Tri-o-tolylphosphine?

There are 3 rotatable bonds present in Tri-o-tolylphosphine.

What is the InChIKey of Tri-o-tolylphosphine?

The InChIKey of Tri-o-tolylphosphine is COIOYMYWGDAQPM-UHFFFAOYSA-N.

What are some other synonyms for Tri-o-tolylphosphine?

Some other synonyms for Tri-o-tolylphosphine include Tri(o-tolyl)phosphine, Phosphine, tris(2-methylphenyl)-, and Tris(2-tolyl)phosphine.

What is the exact mass and monoisotopic mass of Tri-o-tolylphosphine?

The exact mass of Tri-o-tolylphosphine is 304.138087668, and the monoisotopic mass is also 304.138087668.