ligands&coordination complexes / Alfa Chemistry
Banner
Online Inquiry
Verification code

trans-N1,N1-Dimethylcyclohexane-1,2-diamine

Catalog Number ACM67198214
CAS 67198-21-4
Structure {[CurrentData.Name]}
Synonyms 1,2-Cyclohexanediamine, N,N-dimethyl-, trans-
IUPAC Name (1R,2R)-2-N,2-N-dimethylcyclohexane-1,2-diamine
Molecular Weight 142.24
Molecular Formula C8H18N2
InChI FRDZGSBXKJXGNR-HTQZYQBOSA-N
InChI Key InChI=1S/C8H18N2/c1-10(2)8-6-4-3-5-7(8)9/h7-8H,3-6,9H2,1-2H3/t7-,8-/m1/s1
Boiling Point 91 °C at 20 mmHg
Purity 95%
Isomeric SMILES CN(C)[C@@H]1CCCC[C@H]1N
Q&A

What is the CAS number of trans-N1,N1-Dimethylcyclohexane-1,2-diamine?

The CAS number of trans-N1,N1-Dimethylcyclohexane-1,2-diamine is 67198-21-4.

What is the molecular weight of trans-N1,N1-Dimethylcyclohexane-1,2-diamine?

The molecular weight of trans-N1,N1-Dimethylcyclohexane-1,2-diamine is 142.24.

What are some synonyms for trans-N1,N1-Dimethylcyclohexane-1,2-diamine?

Some synonyms for trans-N1,N1-Dimethylcyclohexane-1,2-diamine are listed as: 1,2-Cyclohexanediamine, N,N-dimethyl-, trans-; (1R,2R)-rel-N,N-Dimethyl-1,2-cyclohexanediamine; (1R,2R)-2-N,2-N-dimethylcyclohexane-1,2-diamine; trans-N1,N1-Dimethylcyclohexane-1,2-diamine; and more.

What is the boiling point of trans-N1,N1-Dimethylcyclohexane-1,2-diamine?

The boiling point of trans-N1,N1-Dimethylcyclohexane-1,2-diamine is 91℃ at 20 Torr.

How should trans-N1,N1-Dimethylcyclohexane-1,2-diamine be stored?

Trans-N1,N1-Dimethylcyclohexane-1,2-diamine should be stored under inert gas (nitrogen or Argon) at 2-8 °C.

What is the predicted density of trans-N1,N1-Dimethylcyclohexane-1,2-diamine?

The predicted density of trans-N1,N1-Dimethylcyclohexane-1,2-diamine is 0.92±0.1 g/cm3.

What is the predicted pKa value of trans-N1,N1-Dimethylcyclohexane-1,2-diamine?

The predicted pKa value of trans-N1,N1-Dimethylcyclohexane-1,2-diamine is 10.52±0.70.

What are some uses of rel-(1R,2R)-N,N-Dimethyl-1,2-cyclohexanediamine?

Rel-(1R,2R)-N,N-Dimethyl-1,2-cyclohexanediamine is used as a chiral amine catalyst in asymmetric direct aldol and Michael addition reactions.

How is trans-N1,N1-Dimethylcyclohexane-1,2-diamine commonly referred to in the chemical industry?

Trans-N1,N1-Dimethylcyclohexane-1,2-diamine is commonly referred to as a chiral amine catalyst.

What is the molecular formula of trans-N1,N1-Dimethylcyclohexane-1,2-diamine?

The molecular formula of trans-N1,N1-Dimethylcyclohexane-1,2-diamine is C8H18N2.

Please kindly note that our products and services are for research use only.