trans-Cyclohexane-1,2-diamine

Catalog Number	ACM1121228-1
CAS	1121-22-8
Structure
Synonyms	trans-1,2-Diaminocyclohexane; trans-1,2-Cyclohexanediamine
IUPAC Name	(1R,2R)-cyclohexane-1,2-diamine
Molecular Weight	114.19
Molecular Formula	C6H14N2
InChI	SSJXIUAHEKJCMH-PHDIDXHHSA-N
InChI Key	InChI=1S/C6H14N2/c7-5-3-1-2-4-6(5)8/h5-6H,1-4,7-8H2/t5-,6-/m1/s1
Boiling Point	193.6 °C at 760 mmHg
Melting Point	14-15 °C
Purity	96%
Appearance	Light yellow liquid
Isomeric SMILES	C1CC[C@H]([C@@H](C1)N)N

Q&A

What is the molecular weight of trans-Cyclohexane-1,2-diamine?

The molecular weight of trans-Cyclohexane-1,2-diamine is 114.19.

What are the product categories that trans-Cyclohexane-1,2-diamine belongs to?

trans-Cyclohexane-1,2-diamine belongs to Chiral Nitrogen, DACH&Trost Series, organic amine, Amines (Chiral), Chiral Building Blocks, Synthetic Organic Chemistry, Chiral Compound, chiral, API intermediates, and Chiral reagent.

What is the product name of trans-Cyclohexane-1,2-diamine?

The product name of trans-Cyclohexane-1,2-diamine is (1S,2S)-(+)-1,2-Diaminocyclohexane.

What is the synonym for trans-Cyclohexane-1,2-diamine?

A synonym for trans-Cyclohexane-1,2-diamine is (1S,2S)-Cyclohexane-1,2-Diamin.

What is the chemical formula of trans-Cyclohexane-1,2-diamine?

The chemical formula of trans-Cyclohexane-1,2-diamine is C6H14N2.

What is the melting point of trans-Cyclohexane-1,2-diamine?

The melting point of trans-Cyclohexane-1,2-diamine is 40-43 °C.

How should trans-Cyclohexane-1,2-diamine be stored?

trans-Cyclohexane-1,2-diamine should be kept in a dark place, under an inert atmosphere, at 2-8°C.

What is the optical activity of trans-Cyclohexane-1,2-diamine in 1 M HCl?

The optical activity of trans-Cyclohexane-1,2-diamine in 1 M HCl is [α]20/D +25°.

What are some of the uses of trans-Cyclohexane-1,2-diamine?

trans-Cyclohexane-1,2-diamine is used for the synthesis of optically active products, as a versatile ligand for the formation of metal complexes, and in the synthesis of chiral tropocoronands.

How is trans-Cyclohexane-1,2-diamine typically purified?

trans-Cyclohexane-1,2-diamine can be distilled or recrystallized from pet ether under N2 or Ar.