trans-2-Aminocyclohexanol

Catalog Number	ACM6982394-1
CAS	6982-39-4
IUPAC Name	(1R,2R)-2-aminocyclohexan-1-ol
Molecular Weight	115.17
Molecular Formula	C6H13NO
InChI	PQMCFTMVQORYJC-PHDIDXHHSA-N
InChI Key	InChI=1S/C6H13NO/c7-5-3-1-2-4-6(5)8/h5-6,8H,1-4,7H2/t5-,6-/m1/s1
Purity	96%
Isomeric SMILES	C1CC[C@H]([C@@H](C1)N)O

Q&A

What is the molecular weight of trans-2-Aminocyclohexanol?

The molecular weight of trans-2-Aminocyclohexanol is 115.17.

What are the synonyms for trans-2-Aminocyclohexanol?

The synonyms for trans-2-Aminocyclohexanol include SPECS AN-907/25060015, rel-(1R,2R)-2-aminocyclohexanol, and Cyclohexanol,2-amino-,trans-.

At what temperature does trans-2-Aminocyclohexanol melt?

The melting point of trans-2-Aminocyclohexanol is 68 °C.

What is the predicted density of trans-2-Aminocyclohexanol?

The predicted density of trans-2-Aminocyclohexanol is 1.037±0.06 g/cm3.

In what form does trans-2-Aminocyclohexanol exist?

Trans-2-Aminocyclohexanol exists in the form of a solid.

What is the color of trans-2-Aminocyclohexanol?

The color of trans-2-Aminocyclohexanol is grey.

What is the boiling point of trans-2-Aminocyclohexanol under a pressure of 9 Torr?

The boiling point of trans-2-Aminocyclohexanol under a pressure of 9 Torr is 102-107 °C.

How should trans-2-Aminocyclohexanol be stored?

Trans-2-Aminocyclohexanol should be kept in a dark place, in an inert atmosphere, at room temperature.

What is the pka value predicted for trans-2-Aminocyclohexanol?

The predicted pka value for trans-2-Aminocyclohexanol is 14.94±0.40.

What are some of the uses of rel-(1R,2R)-2-Aminocyclohexanol?

Rel-(1R,2R)-2-Aminocyclohexanol is a useful building block for organic synthesis.