Tin(II) trifluoromethanesulfonate

Catalog Number	ACM62086048-1
CAS	62086-04-8
Structure
Synonyms	Stannous trifluoromethanesulfonate
IUPAC Name	tin(2+);trifluoromethanesulfonate;
Molecular Weight	416.9
Molecular Formula	C2F6O6S2Sn
Canonical SMILES	C(F)(F)(F)S(=O)(=O)[O-].C(F)(F)(F)S(=O)(=O)[O-].[Sn+2]
InChI	InChI=1S/2CHF3O3S.Sn/c2*2-1(3,4)8(5,6)7;/h2*(H,5,6,7);/q;+2/p-2
InChI Key	RBGLVWCAGPITBS-UHFFFAOYSA-L
Melting Point	≥300 °C
Purity	99%
Appearance	Powder
Storage	Refrigerator
Complexity	145
Covalently-Bonded Unit Count	3
Exact Mass	417.806252
Heavy Atom Count	17
Hydrogen Bond Acceptor Count	12
Hydrogen Bond Donor Count	0
Monoisotopic Mass	417.806252
Rotatable Bond Count	0
Topological Polar Surface Area	131 Ų

Q&A

What is the molecular formula of Tin(II) trifluoromethanesulfonate?

The molecular formula is C2F6O6S2Sn.

What is the molecular weight of Tin(II) trifluoromethanesulfonate?

The molecular weight is 416.9 g/mol.

What are some synonyms for Tin(II) trifluoromethanesulfonate?

Some synonyms include Stannous trifluoromethanesulfonate and Tin(II) triflate.

When was Tin(II) trifluoromethanesulfonate created and modified?

It was created on 2005-07-19 and modified on 2023-12-30.

What is the IUPAC Name of Tin(II) trifluoromethanesulfonate?

The IUPAC Name is tin(2+);trifluoromethanesulfonate.

What is the canonical SMILES of Tin(II) trifluoromethanesulfonate?

The canonical SMILES is C(F)(F)(F)S(=O)(=O)[O-].C(F)(F)(F)S(=O)(=O)[O-].[Sn+2].

What is the InChIKey of Tin(II) trifluoromethanesulfonate?

The InChIKey is RBGLVWCAGPITBS-UHFFFAOYSA-L.

What is the CAS number of Tin(II) trifluoromethanesulfonate?

The CAS number is 62086-04-8.

How many hydrogen bond acceptor counts does Tin(II) trifluoromethanesulfonate have?

It has 12 hydrogen bond acceptor counts.

Is Tin(II) trifluoromethanesulfonate a covalently-bonded unit?

Yes, it has a covalently-bonded unit count of 3.