Tetraphenyllead

Catalog Number	ACM595891-1
CAS	595-89-1
Structure
Synonyms	Tetraphenylplumbane
Molecular Weight	515
Molecular Formula	C24H20Pb
Canonical SMILES	C1=CC=C(C=C1)[Pb](C2=CC=CC=C2)(C3=CC=CC=C3)C4=CC=CC=C4
InChI	InChI=1S/4C6H5.Pb/c4*1-2-4-6-5-3-1;/h4*1-5H;
InChI Key	WBJSMHDYLOJVKC-UHFFFAOYSA-N
Melting Point	227-228 °C
Purity	99%
Appearance	Crystal
Exact Mass	516.13315
Hydrogen Bond Acceptor Count	0
Hydrogen Bond Donor Count	0
Monoisotopic Mass	516.13315
Rotatable Bond Count	4
Topological Polar Surface Area	0 Ų

Q&A

What is the molecular formula of tetraphenyllead?

The molecular formula of tetraphenyllead is C24H20Pb.

What is the molecular weight of tetraphenyllead?

The molecular weight of tetraphenyllead is 515 g/mol.

What is the IUPAC name of tetraphenyllead?

The IUPAC name of tetraphenyllead is tetraphenylplumbane.

What is the InChI of tetraphenyllead?

The InChI of tetraphenyllead is InChI=1S/4C6H5.Pb/c4*1-2-4-6-5-3-1;/h4*1-5H.

What is the InChIKey of tetraphenyllead?

The InChIKey of tetraphenyllead is WBJSMHDYLOJVKC-UHFFFAOYSA-N.

What is the canonical SMILES of tetraphenyllead?

The canonical SMILES of tetraphenyllead is C1=CC=C(C=C1)[Pb](C2=CC=CC=C2)(C3=CC=CC=C3)C4=CC=CC=C4.

What is the CAS number of tetraphenyllead?

The CAS number of tetraphenyllead is 595-89-1.

What is the European Community (EC) number of tetraphenyllead?

The European Community (EC) number of tetraphenyllead is 209-871-3.

What is the UNII of tetraphenyllead?

The UNII of tetraphenyllead is 2K9SW63R4N.

Is tetraphenyllead the canonicalized compound?

Yes, tetraphenyllead is the canonicalized compound according to PubChem.