ligands&coordination complexes / Alfa Chemistry
Banner
Online Inquiry
Verification code

Tetramethylammonium bisulfate

Catalog Number ACM80526825-1
CAS 80526-82-5
Structure {[CurrentData.Name]}
Synonyms Tetramethylammonium hydrogen sulfate
IUPAC Name hydrogen sulfate;tetramethylazanium
Molecular Weight 171.22
Molecular Formula C4H13NO4S
InChI DWTYPCUOWWOADE-UHFFFAOYSA-M
InChI Key InChI=1S/C4H12N.H2O4S/c2*1-5(2,3)4/h1-4H3;(H2,1,2,3,4)/q+1;/p-1
Melting Point 295-297 °C
Purity 96%
Appearance White crystalline
Isomeric SMILES C[N+](C)(C)C.OS(=O)(=O)[O-]
Q&A

What is the molecular weight of Tetramethylammonium hydrogen sulfate?

The molecular weight of Tetramethylammonium hydrogen sulfate is 171.22.

What are the product categories that Tetramethylammonium hydrogen sulfate falls under?

Tetramethylammonium hydrogen sulfate falls under quarternary ammonium salts.

What is the melting point of Tetramethylammonium hydrogen sulfate?

The melting point of Tetramethylammonium hydrogen sulfate is 292-295 °C.

What is the color of Tetramethylammonium hydrogen sulfate?

The color of Tetramethylammonium hydrogen sulfate is white crystalline.

What are some synonyms of Tetramethylammonium hydrogen sulfate?

Some synonyms of Tetramethylammonium hydrogen sulfate include TETRAMETHYLAMMONIUM HYDROGEN SULFATE MONOHYDRATE and TetraMethylaMMoniuM hydrogen sulfate 99%.

What are the safety statements associated with Tetramethylammonium hydrogen sulfate?

The safety statement associated with Tetramethylammonium hydrogen sulfate is 26.

How does Tetramethylammonium hydrogen sulfate monohydrate generally exhibit ferroelectricity?

Crystals of Tetramethylammonium hydrogen sulfate monohydrate generally exhibit ferroelectricity in the temperature range from -104 °C to 40 °C.

What are some uses of Tetramethylammonium hydrogen sulfate monohydrate?

Tetramethylammonium hydrogen sulfate monohydrate can be used as a phase transfer catalyst in polymer synthesis.

How does Tetramethylammonium hydrogen sulfate monohydrate appear in its solid form?

Tetramethylammonium hydrogen sulfate monohydrate appears as a white solid.

What is the Chemical Properties of Tetramethylammonium hydrogen sulfate?

The Chemical Properties of Tetramethylammonium hydrogen sulfate is a white solid.

Please kindly note that our products and services are for research use only.