Tetrakis(hydroxymethyl)phosphonium chloride

Catalog Number	ACM124641-1
CAS	124-64-1
Structure
Synonyms	Tetra(Hydroxymethyl)Phosphonium Chloride
IUPAC Name	tetrakis(hydroxymethyl)phosphanium;chloride
Molecular Weight	190.56
Molecular Formula	C4H12ClO4P
InChI	AKXUUJCMWZFYMV-UHFFFAOYSA-M
InChI Key	InChI=1S/C4H12O4P.ClH/c5-1-9(2-6,3-7)4-8;/h5-8H,1-4H2;1H/q+1;/p-1
Boiling Point	115 °C at 760 mmHg
Melting Point	154 °C
Purity	98%+
Density	1.341 g/mL at 25 °C
Appearance	Liquid
Isomeric SMILES	C(O)[P+](CO)(CO)CO.[Cl-]

Q&A

What is the chemical formula of Tetrakis(hydroxymethyl)phosphonium chloride?

The chemical formula is C4H12O4P.Cl.

What is the molecular weight of Tetrakis(hydroxymethyl)phosphonium chloride?

The molecular weight is 190.56g/mol.

What are some of the depositor-supplied synonyms of Tetrakis(hydroxymethyl)phosphonium chloride?

Some synonyms include THPC, Pyroset TKC, and Retardol C.

How many hydrogen bond acceptor counts does Tetrakis(hydroxymethyl)phosphonium chloride have?

It has 5 hydrogen bond acceptor counts.

Is Tetrakis(hydroxymethyl)phosphonium chloride a covalently bonded unit?

Yes, it has a covalently-bonded unit count of 2.

What is the canonical SMILES representation of Tetrakis(hydroxymethyl)phosphonium chloride?

The canonical SMILES is C(O)[P+](CO)(CO)CO.[Cl-].

What is the exact mass of Tetrakis(hydroxymethyl)phosphonium chloride?

The exact mass is 190.0161736.

What is the IUPAC name of Tetrakis(hydroxymethyl)phosphonium chloride?

The IUPAC name is tetrakis(hydroxymethyl)phosphanium;chloride.

What is the UNII number of Tetrakis(hydroxymethyl)phosphonium chloride?

The UNII number is 58WB2XCF8I.