What is the IUPAC name of Tetrakis(diethylamino)phosphonium bromide?
The IUPAC name is tetrakis(diethylamino)phosphanium;bromide.
What is the molecular formula of Tetrakis(diethylamino)phosphonium bromide?
The molecular formula is C16H40BrN4P.
What is the exact mass of Tetrakis(diethylamino)phosphonium bromide?
The exact mass is 398.21740.
How many hydrogen bond acceptors does Tetrakis(diethylamino)phosphonium bromide have?
It has 5 hydrogen bond acceptors.
What is the canonical SMILES representation of Tetrakis(diethylamino)phosphonium bromide?
CCN(CC)[P+](N(CC)CC)(N(CC)CC)N(CC)CC.[Br-]
What is the molecular weight of Tetrakis(diethylamino)phosphonium bromide?
The molecular weight is 399.39g/mol.
How many covalently-bonded units are there in Tetrakis(diethylamino)phosphonium bromide?
There are 2 covalently-bonded units.
What is the InChI key of Tetrakis(diethylamino)phosphonium bromide?
The InChI key is GQSNYNMMDQPIDR-UHFFFAOYSA-M.
What is the topological polar surface area of Tetrakis(diethylamino)phosphonium bromide?
The topological polar surface area is 13.
What are some of the synonyms for Tetrakis(diethylamino)phosphonium bromide?
Some synonyms include tetrakis(diethylamino)phosphanium;bromide, Tetrakis(N,N-diethylamino)phosphorus bromide, and tetrakisdiethylaminophosphonium bromide.
