Tetraethylphosphonium hexafluorophosphate(V)

Catalog Number	ACM111928075-1
CAS	111928-07-5
Structure
IUPAC Name	tetraethylphosphanium;hexafluorophosphate
Molecular Weight	292.18
Molecular Formula	C8H20F6P2
InChI	WJZBUQKNTCKXAE-UHFFFAOYSA-N
InChI Key	InChI=1S/C8H20P.F6P/c1-5-9(6-2,7-3)8-4;1-7(2,3,4,5)6/h5-8H2,1-4H3;/q+1;-1
Purity	98%
Appearance	Solid
Isomeric SMILES	CC[P+](CC)(CC)CC.F[P-](F)(F)(F)(F)F

Q&A

What is the CAS number for Tetraethylphosphonium hexafluorophosphate?

The CAS number for Tetraethylphosphonium hexafluorophosphate is 111928-07-5.

What is the molecular formula of Tetraethylphosphonium hexafluorophosphate?

The molecular formula of Tetraethylphosphonium hexafluorophosphate is C8H20F6P2.

How many heavy atoms are present in Tetraethylphosphonium hexafluorophosphate?

There are 16 heavy atoms present in Tetraethylphosphonium hexafluorophosphate.

What is the exact mass of Tetraethylphosphonium hexafluorophosphate?

The exact mass of Tetraethylphosphonium hexafluorophosphate is 292.09444361.

What is the IUPAC name of Tetraethylphosphonium hexafluorophosphate?

The IUPAC name of Tetraethylphosphonium hexafluorophosphate is tetraethylphosphanium;hexafluorophosphate.

How many hydrogen bond acceptors are there in Tetraethylphosphonium hexafluorophosphate?

There are 7 hydrogen bond acceptors in Tetraethylphosphonium hexafluorophosphate.

How many rotatable bonds are present in Tetraethylphosphonium hexafluorophosphate?

There are 4 rotatable bonds present in Tetraethylphosphonium hexafluorophosphate.

What is the molecular weight of Tetraethylphosphonium hexafluorophosphate?

The molecular weight of Tetraethylphosphonium hexafluorophosphate is 292.18g/mol.

What is the InChIKey for Tetraethylphosphonium hexafluorophosphate?

The InChIKey for Tetraethylphosphonium hexafluorophosphate is WJZBUQKNTCKXAE-UHFFFAOYSA-N.

What are some of the depositor-supplied synonyms for Tetraethylphosphonium hexafluorophosphate?

Some of the depositor-supplied synonyms for Tetraethylphosphonium hexafluorophosphate include SCHEMBL26617321, DTXSID60375226, MFCD01631313, AKOS015833790, CS-0441001, T1746, T71601, and J-002660.