What is the molecular formula of Tetraethylphosphonium trifluoromethanesulfonate?
The molecular formula of Tetraethylphosphonium trifluoromethanesulfonate is C9H20F3O3PS.
What is the molecular weight of Tetraethylphosphonium trifluoromethanesulfonate?
The molecular weight of Tetraethylphosphonium trifluoromethanesulfonate is 296.29g/mol.
What is the exact mass of Tetraethylphosphonium trifluoromethanesulfonate?
The exact mass of Tetraethylphosphonium trifluoromethanesulfonate is 296.08228715.
How many hydrogen bond acceptors are present in Tetraethylphosphonium trifluoromethanesulfonate?
There are 6 hydrogen bond acceptors present in Tetraethylphosphonium trifluoromethanesulfonate.
What is the Canonical SMILES of Tetraethylphosphonium trifluoromethanesulfonate?
The Canonical SMILES of Tetraethylphosphonium trifluoromethanesulfonate is CC[P+](CC)(CC)CC.C(F)(F)(F)S(=O)(=O)[O-].
What is the IUPAC name of Tetraethylphosphonium trifluoromethanesulfonate?
The IUPAC name of Tetraethylphosphonium trifluoromethanesulfonate is tetraethylphosphanium;trifluoromethanesulfonate.
How many covalently-bonded units are present in Tetraethylphosphonium trifluoromethanesulfonate?
There are 2 covalently-bonded units present in Tetraethylphosphonium trifluoromethanesulfonate.
What is the topological polar surface area of Tetraethylphosphonium trifluoromethanesulfonate?
The topological polar surface area of Tetraethylphosphonium trifluoromethanesulfonate is 65.6.
What is the InChIKey of Tetraethylphosphonium trifluoromethanesulfonate?
The InChIKey of Tetraethylphosphonium trifluoromethanesulfonate is BPYSJOQJBAZTDB-UHFFFAOYSA-M.
What is the depositor-supplied synonym of Tetraethylphosphonium trifluoromethanesulfonate?
The depositor-supplied synonym of Tetraethylphosphonium trifluoromethanesulfonate is 111928-06-4.
