Tetraethyl 1,4,8,11-Tetraazacyclotetradecane-1,4,8,11-tetraacetate

Catalog Number	ACM126320578-2
CAS	126320-57-8
Structure
Synonyms	1,4,8,11-Tetraazacyclotetradecane-1,4,8,11-tetraacetic acid, 1,4,8,11-tetraethyl ester
IUPAC Name	ethyl 2-[4,8,11-tris(2-ethoxy-2-oxoethyl)-1,4,8,11-tetrazacyclotetradec-1-yl]acetate
Molecular Weight	544.68
Molecular Formula	C26H48N4O8
Canonical SMILES	CCOC(=O)CN1CCCN(CCN(CCCN(CC1)CC(=O)OCC)CC(=O)OCC)CC(=O)OCC
InChI	HGPDBLIYOCNCEH-UHFFFAOYSA-N
InChI Key	InChI=1S/C26H48N4O8/c1-5-35-23(31)19-27-11-9-12-29(21-25(33)37-7-3)17-18-30(22-26(34)38-8-4)14-10-13-28(16-15-27)20-24(32)36-6-2/h5-22H2,1-4H3
Melting Point	87-89 °C
Purity	98%
Appearance	White to yellow powder
Complexity	595
Covalently-Bonded Unit Count	1
Exact Mass	544.34721450
Heavy Atom Count	38
Hydrogen Bond Acceptor Count	12
Hydrogen Bond Donor Count	0
Monoisotopic Mass	544.34721450
Rotatable Bond Count	16
Topological Polar Surface Area	118 Ų

Q&A

What is the molecular weight of Tetraethyl 1,4,8,11-Tetraazacyclotetradecane-1,4,8,11-tetraacetate?

The molecular weight is 544.68.

In what product categories does Tetraethyl 1,4,8,11-Tetraazacyclotetradecane-1,4,8,11-tetraacetate fall under?

It falls under Achiral Nitrogen, Cy-N, Azacrown Ethers, Functional Materials, and Macrocycles for Host-Guest Chemistry.

What is the product name of Tetraethyl 1,4,8,11-Tetraazacyclotetradecane-1,4,8,11-tetraacetate?

The product name is 1,4,8,11-Tetrakis(ethoxycarbonylmethyl)-1,4,8,11-tetraazacyclotetradecane.

What are some synonyms for Tetraethyl 1,4,8,11-Tetraazacyclotetradecane-1,4,8,11-tetraacetate?

Some synonyms include TETAEt, Tetraethyl 1,4,8,11-Tetraazacyclotetradecane-1,4,8,11-tetraacetate, and others.

What is the melting point of Tetraethyl 1,4,8,11-Tetraazacyclotetradecane-1,4,8,11-tetraacetate?

The melting point is 87-89°C.

How is Tetraethyl 1,4,8,11-Tetraazacyclotetradecane-1,4,8,11-tetraacetate stored?

It is stored under inert gas (nitrogen or argon) at 2-8°C.

What is the color of Tetraethyl 1,4,8,11-Tetraazacyclotetradecane-1,4,8,11-tetraacetate?

It is white to yellow in color.

What is the CAS DataBase Reference number for Tetraethyl 1,4,8,11-Tetraazacyclotetradecane-1,4,8,11-tetraacetate?

The CAS DataBase Reference number is 126320-57-8.

What is the HS Code for Tetraethyl 1,4,8,11-Tetraazacyclotetradecane-1,4,8,11-tetraacetate?

The HS Code is 2933.99.9701.

What is the form of Tetraethyl 1,4,8,11-Tetraazacyclotetradecane-1,4,8,11-tetraacetate?

It is in powder form and is hygroscopic.