What is the CAS number for Tetrabutylphosphoniumtoluene-4-sulfonate?
The CAS number for Tetrabutylphosphoniumtoluene-4-sulfonate is 116237-97-9.
What is the Canonical SMILES of Tetrabutylphosphoniumtoluene-4-sulfonate?
The Canonical SMILES of Tetrabutylphosphoniumtoluene-4-sulfonate is CCCC[P+](CCCC)(CCCC)CCCC.CC1=CC=C(C=C1)S(=O)(=O)[O-].
How many Covalently-Bonded Unit Count are there in Tetrabutylphosphoniumtoluene-4-sulfonate?
There are 2 Covalently-Bonded Unit Count in Tetrabutylphosphoniumtoluene-4-sulfonate.
What is the Molecular Weight of Tetrabutylphosphoniumtoluene-4-sulfonate?
The Molecular Weight of Tetrabutylphosphoniumtoluene-4-sulfonate is 430.6g/mol.
How many Heavy Atoms are present in Tetrabutylphosphoniumtoluene-4-sulfonate?
There are 28 Heavy Atoms present in Tetrabutylphosphoniumtoluene-4-sulfonate.
What is the IUPAC Name of Tetrabutylphosphoniumtoluene-4-sulfonate?
The IUPAC Name of Tetrabutylphosphoniumtoluene-4-sulfonate is 4-methylbenzenesulfonate;tetrabutylphosphanium.
What is the Monoisotopic Mass of Tetrabutylphosphoniumtoluene-4-sulfonate?
The Monoisotopic Mass of Tetrabutylphosphoniumtoluene-4-sulfonate is 430.26705340.
How many Hydrogen Bond Acceptor Counts are there in Tetrabutylphosphoniumtoluene-4-sulfonate?
There are 3 Hydrogen Bond Acceptor Counts in Tetrabutylphosphoniumtoluene-4-sulfonate.
What is the Topological Polar Surface Area of Tetrabutylphosphoniumtoluene-4-sulfonate?
The Topological Polar Surface Area of Tetrabutylphosphoniumtoluene-4-sulfonate is 65.6.
What is the exact InChIKey of Tetrabutylphosphoniumtoluene-4-sulfonate?
The exact InChIKey of Tetrabutylphosphoniumtoluene-4-sulfonate is FBYJOCBDWDVDOJ-UHFFFAOYSA-M.