What is the CAS number for Tetrabutylphosphoniummethanesulfonate?
The CAS number for Tetrabutylphosphoniummethanesulfonate is 98342-59-7.
What is the Canonical SMILES representation of Tetrabutylphosphoniummethanesulfonate?
The Canonical SMILES representation of Tetrabutylphosphoniummethanesulfonate is CCCC[P+](CCCC)(CCCC)CCCC.CS(=O)(=O)[O-].
How many heavy atoms are present in the structure of Tetrabutylphosphoniummethanesulfonate?
There are 22 heavy atoms present in the structure of Tetrabutylphosphoniummethanesulfonate.
What is the molecular formula of Tetrabutylphosphoniummethanesulfonate?
The molecular formula of Tetrabutylphosphoniummethanesulfonate is C17H39O3PS.
What is the name of the chemical in the IUPAC name representation of Tetrabutylphosphoniummethanesulfonate?
The name of the chemical in the IUPAC name representation is methanesulfonate.
What is the molecular weight of Tetrabutylphosphoniummethanesulfonate?
The molecular weight of Tetrabutylphosphoniummethanesulfonate is 354.5g/mol.
How many rotatable bonds are present in Tetrabutylphosphoniummethanesulfonate?
There are 12 rotatable bonds present in Tetrabutylphosphoniummethanesulfonate.
What is the Computed Properties Hydrogen Bond Acceptor Count for Tetrabutylphosphoniummethanesulfonate?
The Computed Properties Hydrogen Bond Acceptor Count is 3 for Tetrabutylphosphoniummethanesulfonate.
What is the Monoisotopic Mass of Tetrabutylphosphoniummethanesulfonate?
The Monoisotopic Mass of Tetrabutylphosphoniummethanesulfonate is 354.23575327.
What is the European Community (EC) Number for Tetrabutylphosphoniummethanesulfonate?
The European Community (EC) Number for Tetrabutylphosphoniummethanesulfonate is 627-943-6.