Tetrabutylphosphoniumhydrogensulfate

Catalog Number	ACM108203016-1
CAS	108203-01-6
Structure
Synonyms	Hydrogen sulfate,tetrabutylphosphanium
IUPAC Name	hydrogen sulfate;tetrabutylphosphanium
Molecular Weight	356.50
Molecular Formula	C16H37O4PS
InChI	YXBZWFCHTPBJEK-UHFFFAOYSA-M
InChI Key	InChI=1S/C16H36P.H2O4S/c1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;1-5(2,3)4/h5-16H2,1-4H3;(H2,1,2,3,4)/q+1;/p-1
Appearance	Solid
Isomeric SMILES	CCCC[P+](CCCC)(CCCC)CCCC.OS(=O)(=O)[O-]

Q&A

What is the chemical structure of Tetrabutylphosphonium hydrogensulfate?

The chemical structure of Tetrabutylphosphonium hydrogensulfate is C16H37O4PS.

What is the CAS number for Tetrabutylphosphonium hydrogensulfate?

The CAS number for Tetrabutylphosphonium hydrogensulfate is 108203-01-6.

What is the molecular weight of Tetrabutylphosphonium hydrogensulfate?

The molecular weight of Tetrabutylphosphonium hydrogensulfate is 356.5g/mol.

How many hydrogen bond acceptors does Tetrabutylphosphonium hydrogensulfate have?

Tetrabutylphosphonium hydrogensulfate has 4 hydrogen bond acceptors.

What is the IUPAC name of Tetrabutylphosphonium hydrogensulfate?

The IUPAC name of Tetrabutylphosphonium hydrogensulfate is hydrogen sulfate;tetrabutylphosphanium.

How many defined atom stereocenters does Tetrabutylphosphonium hydrogensulfate have?

Tetrabutylphosphonium hydrogensulfate has 0 defined atom stereocenters.

What is the Canonical SMILES representation of Tetrabutylphosphonium hydrogensulfate?

The Canonical SMILES representation of Tetrabutylphosphonium hydrogensulfate is CCCC[P+](CCCC)(CCCC)CCCC.OS(=O)(=O)[O-].

What is the InChIKey for Tetrabutylphosphonium hydrogensulfate?

The InChIKey for Tetrabutylphosphonium hydrogensulfate is YXBZWFCHTPBJEK-UHFFFAOYSA-M.

What is the Computed Properties Rotatable Bond Count for Tetrabutylphosphonium hydrogensulfate?

The Computed Properties Rotatable Bond Count for Tetrabutylphosphonium hydrogensulfate is 12.

What is the topological polar surface area of Tetrabutylphosphonium hydrogensulfate?

The topological polar surface area of Tetrabutylphosphonium hydrogensulfate is 85.8.