Tetrabutylphosphoniumbutylsulfate

Catalog Number	ACM654057995-1
CAS	654057-99-5
Structure
Synonyms	Butyl sulfate,tetrabutylphosphanium
IUPAC Name	butyl sulfate;tetrabutylphosphanium
Molecular Weight	412.61
Molecular Formula	C20H45O4PS
InChI	RFUIKCZZWAUNGF-UHFFFAOYSA-M
InChI Key	InChI=1S/C16H36P.C4H10O4S/c1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;1-2-3-4-8-9(5,6)7/h5-16H2,1-4H3;2-4H2,1H3,(H,5,6,7)/q+1;/p-1
Purity	98%
Isomeric SMILES	CCCCOS(=O)(=O)[O-].CCCC[P+](CCCC)(CCCC)CCCC

Q&A

What is the CAS number for Tetrabutylphosphoniumbutylsulfate?

The CAS number for Tetrabutylphosphoniumbutylsulfate is 654057-99-5.

What is the Canonical SMILES representation of Tetrabutylphosphoniumbutylsulfate?

The Canonical SMILES representation of Tetrabutylphosphoniumbutylsulfate is CCCCOS(=O)(=O)[O-].CCCC[P+](CCCC)(CCCC)CCCC.

How many heavy atoms are present in Tetrabutylphosphoniumbutylsulfate?

There are 26 heavy atoms present in Tetrabutylphosphoniumbutylsulfate.

What is the molecular weight of Tetrabutylphosphoniumbutylsulfate?

The molecular weight of Tetrabutylphosphoniumbutylsulfate is 412.6 g/mol.

What is the IUPAC name of Tetrabutylphosphoniumbutylsulfate?

The IUPAC name of Tetrabutylphosphoniumbutylsulfate is butyl sulfate;tetrabutylphosphanium.

How many hydrogen bond acceptors are present in Tetrabutylphosphoniumbutylsulfate?

There are 4 hydrogen bond acceptors present in Tetrabutylphosphoniumbutylsulfate.

What is the Exact Mass of Tetrabutylphosphoniumbutylsulfate?

The Exact Mass of Tetrabutylphosphoniumbutylsulfate is 412.27761808.

What is the Monoisotopic Mass of Tetrabutylphosphoniumbutylsulfate?

The Monoisotopic Mass of Tetrabutylphosphoniumbutylsulfate is 412.27761808.

How many rotatable bonds are present in Tetrabutylphosphoniumbutylsulfate?

There are 15 rotatable bonds present in Tetrabutylphosphoniumbutylsulfate.

What are some of the depositor-supplied synonyms for Tetrabutylphosphoniumbutylsulfate?

Some depositor-supplied synonyms for Tetrabutylphosphoniumbutylsulfate are tetrabutylphosphanium butyl sulfate, SCHEMBL4427096, and FT-0765713.