ligands&coordination complexes / Alfa Chemistry
Banner
Online Inquiry
Verification code

tert-Butyl (cis-2-aminocyclohexyl)carbamate

Catalog Number ACM184954754-1
CAS 184954-75-4
Structure {[CurrentData.Name]}
Synonyms cis-N1-(tert-Butoxycarbonyl)-1,2-cyclohexanediamine; cis-N1-Boc-1,2-cyclohexanediamine
IUPAC Name tert-butyl N-[(1R,2S)-2-aminocyclohexyl]carbamate
Molecular Weight 214.30
Molecular Formula C11H22N2O2
InChI AKVIZYGPJIWKOS-DTWKUNHWSA-N
InChI Key InChI=1S/C11H22N2O2/c1-11(2,3)15-10(14)13-9-7-5-4-6-8(9)12/h8-9H,4-7,12H2,1-3H3,(H,13,14)/t8-,9+/m0/s1
Boiling Point 322.1±31.0 °C at 760 mmHg
Purity 97%
Appearance Solid
Isomeric SMILES CC(C)(C)OC(=O)N[C@@H]1CCCC[C@@H]1N
Q&A

What is the chemical formula of tert-Butyl (cis-2-aminocyclohexyl)carbamate?

The chemical formula is C11H22N2O2.

What is the molecular weight of tert-Butyl (cis-2-aminocyclohexyl)carbamate?

The molecular weight is 214.3.

What are the synonyms for tert-Butyl (cis-2-aminocyclohexyl)carbamate?

The synonyms include 1-N-BOC-1,2-CIS-CYCLOHEXYLDIAMINE, 1-N-Boc-cis-1,2-cyclohexyldiamine, and N-[(1R,2S)-2-aMinocyclohexyl]-, CarbaMic acid, 1,1-diMethylethyl ester.

What is the melting point of tert-Butyl (cis-2-aminocyclohexyl)carbamate?

The melting point is 46 °C.

In what form does tert-Butyl (cis-2-aminocyclohexyl)carbamate exist?

It exists in powder to lump form.

Is tert-Butyl (cis-2-aminocyclohexyl)carbamate soluble in Methanol?

Yes, it is soluble in Methanol.

Under what storage temperature should tert-Butyl (cis-2-aminocyclohexyl)carbamate be kept?

It should be stored under inert gas (nitrogen or Argon) at 2-8 °C.

What is the predicted boiling point of tert-Butyl (cis-2-aminocyclohexyl)carbamate?

The predicted boiling point is 322.1±31.0 °C.

What color does tert-Butyl (cis-2-aminocyclohexyl)carbamate have?

It is white to almost white in color.

What are the hazard and safety statements associated with tert-Butyl (cis-2-aminocyclohexyl)carbamate?

The hazard code is Xi, and safety statements include 26-36/39.

Please kindly note that our products and services are for research use only.