Sodium 3-(diphenylphosphino)benzenesulfonate

Catalog Number	ACM63995755-1
CAS	63995-75-5
Structure
Synonyms	Diphenylphosphinobenzene-3-sulfonic Acid Sodium Salt; Triphenylphosphine-3-sulfonic Acid Sodium Salt
IUPAC Name	sodium;3-diphenylphosphanylbenzenesulfonate
Molecular Weight	364.33
Molecular Formula	C18H14NaO3PS
InChI	NTUROZDXWLPVHB-UHFFFAOYSA-M
InChI Key	InChI=1S/C18H15O3PS.Na/c19-23(20,21)18-13-7-12-17(14-18)22(15-8-3-1-4-9-15)16-10-5-2-6-11-16;/h1-14H,(H,19,20,21);/q;+1/p-1
Purity	90%
Appearance	Solid
Isomeric SMILES	C1=CC=C(C=C1)P(C2=CC=CC=C2)C3=CC(=CC=C3)S(=O)(=O)[O-].[Na+]

Q&A

What is the CAS number for Sodium 3-(diphenylphosphino)benzenesulfonate?

The CAS number for Sodium 3-(diphenylphosphino)benzenesulfonate is 63995-75-5.

What is the molecular weight of Sodium 3-(diphenylphosphino)benzenesulfonate?

The molecular weight of Sodium 3-(diphenylphosphino)benzenesulfonate is 364.3g/mol.

What is the IUPAC name for Sodium 3-(diphenylphosphino)benzenesulfonate?

The IUPAC name for Sodium 3-(diphenylphosphino)benzenesulfonate is sodium;3-diphenylphosphanylbenzenesulfonate.

What is the molecular formula of Sodium 3-(diphenylphosphino)benzenesulfonate?

The molecular formula of Sodium 3-(diphenylphosphino)benzenesulfonate is C18H14NaO3PS.

How many heavy atoms are present in the Sodium 3-(diphenylphosphino)benzenesulfonate molecule?

There are 24 heavy atoms present in the Sodium 3-(diphenylphosphino)benzenesulfonate molecule.

What is the topological polar surface area of Sodium 3-(diphenylphosphino)benzenesulfonate?

The topological polar surface area of Sodium 3-(diphenylphosphino)benzenesulfonate is 65.6.

What is the exact mass of Sodium 3-(diphenylphosphino)benzenesulfonate?

The exact mass of Sodium 3-(diphenylphosphino)benzenesulfonate is 364.02989676.

What is the Canonical SMILES representation of Sodium 3-(diphenylphosphino)benzenesulfonate?

The Canonical SMILES representation of Sodium 3-(diphenylphosphino)benzenesulfonate is C1=CC=C(C=C1)P(C2=CC=CC=C2)C3=CC(=CC=C3)S(=O)(=O)[O-].[Na+].

What is the Computed Properties Rotatable Bond Count for Sodium 3-(diphenylphosphino)benzenesulfonate?

The Computed Properties Rotatable Bond Count for Sodium 3-(diphenylphosphino)benzenesulfonate is 4.

What are some of the depositor-supplied synonyms for Sodium 3-(diphenylphosphino)benzenesulfonate?

Some of the depositor-supplied synonyms for Sodium 3-(diphenylphosphino)benzenesulfonate are Triphenylphosphine-3-sulfonic acid sodium salt, TPPMS, SCHEMBL220906, and D2043.