What is the name of (SA,S)-DTB-Ph-SIPHOX (SA,S)-DTB-Ph-SIPHOX also known as?
The compound (SA,S)-DTB-Ph-SIPHOX is also known as "bis(3,5-ditert-butylphenyl)-[(3S)-4-[(4S)-4-phenyl-4,5-dihydro-1,3-oxazol-2-yl]-3,3'-spirobi[1,2-dihydroindene]-4'-yl]phosphane".
What is the molecular formula of (SA,S)-DTB-Ph-SIPHOX?
The molecular formula of (SA,S)-DTB-Ph-SIPHOX is C54H64NOP.
What is the molecular weight of (SA,S)-DTB-Ph-SIPHOX?
The molecular weight of (SA,S)-DTB-Ph-SIPHOX is 774.1g/mol.
What is the canonical SMILES representation of (SA,S)-DTB-Ph-SIPHOX?
The canonical SMILES representation of (SA,S)-DTB-Ph-SIPHOX is
CC(C)(C)C1=CC(=CC(=C1)P(C2=CC=CC3=C2C4(CCC5=C4C(=CC=C5)C6=NC(CO6)C7=CC=CC=C7)CC3)C8=CC(=CC(=C8)C(C)(C)C)C(C)(C)C)C(C)(C)C.
How many hydrogen bond acceptors are there in (SA,S)-DTB-Ph-SIPHOX?
There are 2 hydrogen bond acceptors in (SA,S)-DTB-Ph-SIPHOX.
How many rotatable bonds are there in (SA,S)-DTB-Ph-SIPHOX?
There are 9 rotatable bonds in (SA,S)-DTB-Ph-SIPHOX.
What is the XLogP3 value of (SA,S)-DTB-Ph-SIPHOX?
The XLogP3 value of (SA,S)-DTB-Ph-SIPHOX is 15.4.
What is the ChEBI ID of (SA,S)-DTB-Ph-SIPHOX?
The ChEBI ID of (SA,S)-DTB-Ph-SIPHOX is CHEBI:143667.
What is the CAS registry number of (SA,S)-DTB-Ph-SIPHOX?
The CAS registry number of (SA,S)-DTB-Ph-SIPHOX is 1040274-12-1.
What is the InChIKey of (SA,S)-DTB-Ph-SIPHOX?
The InChIKey of (SA,S)-DTB-Ph-SIPHOX is JIDAICRIWADNJH-JWRVDXLXSA-N.