(S,S)-1,2-Bis(t-butylmethylphosphino)benzene (S,S)-BenzP

Catalog Number	ACM1355162854
CAS	1355162-85-4
Structure
Synonyms	(S,S)-BenzP; (S,S)-1,2-bis(tert-butylmethylphosphino)benzene
IUPAC Name	tert-butyl-[2-[tert-butyl(methyl)phosphanyl]phenyl]-methylphosphane
Molecular Weight	282.34
Molecular Formula	C16H28P2
InChI	JFUWTGUCFKJVST-UHFFFAOYSA-N
InChI Key	InChI=1S/C16H28P2/c1-15(2,3)17(7)13-11-9-10-12-14(13)18(8)16(4,5)6/h9-12H,1-8H3
Boiling Point	362.3±25.0 °C(Predicted)
Purity	98%
Isomeric SMILES	CC(C)(C)P(C)C1=CC=CC=C1P(C)C(C)(C)C

Q&A

What is the molecular formula of (S,S)-1,2-Bis(t-butylmethylphosphino)benzene?

The molecular formula is C16H28P2.

What is the exact mass of (S,S)-1,2-Bis(t-butylmethylphosphino)benzene (S,S)-BenzP?

The exact mass is 282.16662489.

Can you provide the IUPAC name of (S,S)-1,2-Bis(t-butylmethylphosphino)benzene (S,S)-BenzP?

The IUPAC name is tert-butyl-[2-[tert-butyl(methyl)phosphanyl]phenyl]-methylphosphane.

How many heavy atoms are present in (S,S)-1,2-Bis(t-butylmethylphosphino)benzene (S,S)-BenzP?

There are 18 heavy atoms present.

What is the Canonical SMILES representation of (S,S)-1,2-Bis(t-butylmethylphosphino)benzene (S,S)-BenzP?

The Canonical SMILES representation is CC(C)(C)P(C)C1=CC=CC=C1P(C)C(C)(C)C.

What is the CAS number of (S,S)-1,2-Bis(t-butylmethylphosphino)benzene?

The CAS number is 919778-41-9.

How many rotatable bonds does (S,S)-1,2-Bis(t-butylmethylphosphino)benzene (S,S)-BenzP have?

The compound has 4 rotatable bonds.

What is the XLogP3 value of (S,S)-1,2-Bis(t-butylmethylphosphino)benzene (S,S)-BenzP?

The XLogP3 value is 3.

How many defined atom stereocenters are present in (S,S)-1,2-Bis(t-butylmethylphosphino)benzene (S,S)-BenzP?

There are 0 defined atom stereocenters.

What is the molecular weight of (S,S)-1,2-Bis(t-butylmethylphosphino)benzene?

The molecular weight is 282.34g/mol.