What is the name of (S,R)-YanPhos represented?
The compound represented is (S,R)-YanPhos.
What is the Molecular Formula of (S,R)-YanPhos?
The Molecular Formula of (S,R)-YanPhos is C59H41NO2P2.
What is the Molecular Weight of (S,R)-YanPhos?
The Molecular Weight of (S,R)-YanPhos is 857.9g/mol.
What is the InChI of (S,R)-YanPhos?
The InChI of (S,R)-YanPhos is InChI=1S/C59H41NO2P2/c1-4-18-41(19-5-1)40-60(64-61-53-37-33-43-21-11-15-29-49(43)57(53)58-50-30-16-12-22
How many Heavy Atom Count is (S,R)-YanPhos composed of?
(S,R)-YanPhos is composed of 64 Heavy Atoms.
What is the Computed Properties Formal Charge of (S,R)-YanPhos?
The Computed Properties Formal Charge of (S,R)-YanPhos is 0.
How many Rotatable Bond Count does (S,R)-YanPhos have?
(S,R)-YanPhos has 8 Rotatable Bond Counts.
What is the Topological Polar Surface Area of (S,R)-YanPhos?
The Topological Polar Surface Area of (S,R)-YanPhos is 29.5.
What is the Canonical SMILES representation of (S,R)-YanPhos?
The Canonical SMILES representation of (S,R)-YanPhos is C1=CC=C(C=C1)CN(C2=C(C3=CC=CC=C3C=C2)C4=C(C=CC5=CC=CC=C54)P(C6=CC=CC=C6)C7=CC=CC=C7)P8OC9=C(C1=CC=CC=C1C=C9)C1=C(O8)C=CC2=CC=CC=C21.
What is the Exact Mass of (S,R)-YanPhos?
The Exact Mass of (S,R)-YanPhos is 857.26125355.
