ligands&coordination complexes / Alfa Chemistry
Banner
Online Inquiry
Verification code

(S)-N-((R)-(2-(Diphenylphosphanyl)phenyl)(4-methoxyphenyl)methyl)-2-methylpropane-2-sulfinamide

Catalog Number ACMA00040965
Molecular Weight 501.62
Molecular Formula C30H32NO2PS
Purity 98%
Q&A

What is the molecular formula of (S)-N-((R)-(2-(Diphenylphosphanyl)phenyl)(4-methoxyphenyl)methyl)-2-methylpropane-2-sulfinamide?

The molecular formula is C30H32NO2PS.

What is the exact mass of (S)-N-((R)-(2-(Diphenylphosphanyl)phenyl)(4-methoxyphenyl)methyl)-2-methylpropane-2-sulfinamide?

The exact mass is 501.18913743.

What are the defined atom stereocenter count and the undefined atom stereocenter count?

The defined atom stereocenter count is 1 and the undefined atom stereocenter count is 1.

How many heavy atoms are present in (S)-N-((R)-(2-(Diphenylphosphanyl)phenyl)(4-methoxyphenyl)methyl)-2-methylpropane-2-sulfinamide?

There are 35 heavy atoms in (S)-N-((R)-(2-(Diphenylphosphanyl)phenyl)(4-methoxyphenyl)methyl)-2-methylpropane-2-sulfinamide.

What is the Canonical SMILES of (S)-N-((R)-(2-(Diphenylphosphanyl)phenyl)(4-methoxyphenyl)methyl)-2-methylpropane-2-sulfinamide?

CC(C)(C)S(=O)NC(C1=CC=C(C=C1)OC)C2=CC=CC=C2P(C3=CC=CC=C3)C4=CC=CC=C4

What is the topological polar surface area of (S)-N-((R)-(2-(Diphenylphosphanyl)phenyl)(4-methoxyphenyl)methyl)-2-methylpropane-2-sulfinamide?

The topological polar surface area is 57.5.

What are the hydrogen bond acceptor count and the hydrogen bond donor count?

The hydrogen bond acceptor count is 4 and the hydrogen bond donor count is 1.

What is the formal charge of (S)-N-((R)-(2-(Diphenylphosphanyl)phenyl)(4-methoxyphenyl)methyl)-2-methylpropane-2-sulfinamide?

The formal charge is 0.

What is the IUPAC name of (S)-N-((R)-(2-(Diphenylphosphanyl)phenyl)(4-methoxyphenyl)methyl)-2-methylpropane-2-sulfinamide?

The IUPAC name is N-[(R)-(2-diphenylphosphanylphenyl)-(4-methoxyphenyl)methyl]-2-methylpropane-2-sulfinamide.

What is the InChIKey of (S)-N-((R)-(2-(Diphenylphosphanyl)phenyl)(4-methoxyphenyl)methyl)-2-methylpropane-2-sulfinamide?

The InChIKey is JSJZIHJKTOOMLL-ZMLFZXNESA-N.

Please kindly note that our products and services are for research use only.