ligands&coordination complexes / Alfa Chemistry
Banner
Online Inquiry
Verification code

S-3,3'-Bis(phenyl)-1,1'-binaphthyl-2,2'-diyl hydrogenphosphate

Catalog Number ACM874948591-1
CAS 874948-59-1
Structure {[CurrentData.Name]}
Synonyms (11bS)-4-Hydroxy-2,6-diphenyldinaphtho[2,1-d:1',2'-f][1,3,2]dioxaphosphepine 4-oxide
IUPAC Name 13-hydroxy-10,16-diphenyl-12,14-dioxa-13-5-phosphapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(15),2(11),3,5,7,9,16,18,20,22-decaene 13-oxide
Molecular Weight 500.48
Molecular Formula C32H21O4P
Canonical SMILES C1=CC=C(C=C1)C2=CC3=CC=CC=C3C4=C2OP(=O)(OC5=C4C6=CC=CC=C6C=C5C7=CC=CC=C7)O
InChI RLPAIZCRXBEKDM-UHFFFAOYSA-N
InChI Key InChI=1S/C32H21O4P/c33-37(34)35-31-27(21-11-3-1-4-12-21)19-23-15-7-9-17-25(23)29(31)30-26-18-10-8-16-24(26)20-28(32(30)36-37)22-13-5-2-6-14-22/h1-20H,(H,33,34)
Boiling Point 755.1±70.0 °C(Predicted)
Exact Mass 500.11774614
Heavy Atom Count 37
Hydrogen Bond Acceptor Count 4
Hydrogen Bond Donor Count 1
Monoisotopic Mass 500.11774614
Rotatable Bond Count 2
Topological Polar Surface Area 55.8 Ų
Q&A

What is the molecular weight of S-3,3'-Bis(phenyl)-1,1'-binaphthyl-2,2'-diyl hydrogenphosphate?

The molecular weight is 500.48.

What are some synonyms for S-3,3'-Bis(phenyl)-1,1'-binaphthyl-2,2'-diyl hydrogenphosphate?

Some synonyms include (S)-2,2'-Dihydroxy-3,3'-diphenyl-1,1'-binaphthalene cyclic phosphate, and (S)-3,3'-Diphenyl-1,1'-binaphthyl-2,2'-diyl Hydrogen Phosphate.

What is the boiling point of S-3,3'-Bis(phenyl)-1,1'-binaphthyl-2,2'-diyl hydrogenphosphate?

The boiling point is predicted to be 755.1±70.0 °C.

What is the recommended storage temperature for S-3,3'-Bis(phenyl)-1,1'-binaphthyl-2,2'-diyl hydrogenphosphate?

It is recommended to store it under inert gas (nitrogen or Argon) at 2-8°C.

In what form does S-3,3'-Bis(phenyl)-1,1'-binaphthyl-2,2'-diyl hydrogenphosphate come?

It comes in the form of a powder.

What is the predicted density of S-3,3'-Bis(phenyl)-1,1'-binaphthyl-2,2'-diyl hydrogenphosphate?

The predicted density is 1.43±0.1 g/cm3.

What is the predicted pka value of S-3,3'-Bis(phenyl)-1,1'-binaphthyl-2,2'-diyl hydrogenphosphate?

The predicted pka value is 1.12±0.20.

What is the color of S-3,3'-Bis(phenyl)-1,1'-binaphthyl-2,2'-diyl hydrogenphosphate?

The color is white to light-yellow.

What is the chemical formula of S-3,3'-Bis(phenyl)-1,1'-binaphthyl-2,2'-diyl hydrogenphosphate?

The chemical formula is C32H21O4P.

What is the PubChem ID of S-3,3'-Bis(phenyl)-1,1'-binaphthyl-2,2'-diyl hydrogenphosphate?

The PubChem ID is 12151052.

Please kindly note that our products and services are for research use only.