(S)-5-Benzyl-2-(thiophen-2-yl)-4,5-dihydrooxazole

Catalog Number	ACM1245618567
CAS	1245618-56-7
Synonyms	(5S)-5-Benzyl-2-thiophen-2-yl-4,5-dihydro-1,3-oxazol
IUPAC Name	(5S)-5-benzyl-2-thiophen-2-yl-4,5-dihydro-1,3-oxazole
Molecular Weight	243.32
Molecular Formula	C14H13NOS
InChI	ITGLEXFUOYJYSZ-LBPRGKRZSA-N
InChI Key	InChI=1S/C14H13NOS/c1-2-5-11(6-3-1)9-12-10-15-14(16-12)13-7-4-8-17-13/h1-8,12H,9-10H2/t12-/m0/s1
Purity	95%+
Isomeric SMILES	C1[C@@H](OC(=N1)C2=CC=CS2)CC3=CC=CC=C3

Q&A

What is the molecular weight of (S)-5-Benzyl-2-(thiophen-2-yl)-4,5-dihydrooxazole?

The molecular weight of (S)-5-Benzyl-2-(thiophen-2-yl)-4,5-dihydrooxazole is 243.32412.

What is the molecular formula of (S)-5-Benzyl-2-(thiophen-2-yl)-4,5-dihydrooxazole?

The molecular formula is C14H13NOS.

What is the product name for (S)-5-Benzyl-2-(thiophen-2-yl)-4,5-dihydrooxazole?

The product name is (S)-5-Benzyl-2-(thiophen-2-yl)-4,5-dihydrooxazole.

Are there any synonyms for (S)-5-Benzyl-2-(thiophen-2-yl)-4,5-dihydrooxazole?

Yes, the synonym for (S)-5-Benzyl-2-(thiophen-2-yl)-4,5-dihydrooxazole is the same as the product name.

How many carbon atoms are present in the molecule of (S)-5-Benzyl-2-(thiophen-2-yl)-4,5-dihydrooxazole?

There are 14 carbon atoms present in the molecule.

How many hydrogen atoms are present in the molecule of (S)-5-Benzyl-2-(thiophen-2-yl)-4,5-dihydrooxazole?

There are 13 hydrogen atoms present in the molecule.

How many nitrogen atoms are present in the molecule of (S)-5-Benzyl-2-(thiophen-2-yl)-4,5-dihydrooxazole?

There is 1 nitrogen atom present in the molecule.

How many oxygen atoms are present in the molecule of (S)-5-Benzyl-2-(thiophen-2-yl)-4,5-dihydrooxazole?

There is 1 oxygen atom present in the molecule.

What is the role of the thiophen-2-yl group in the structure of the molecule?

The thiophen-2-yl group contributes to the aromatic properties of the molecule.

How is the (S)-5-Benzyl-2-(thiophen-2-yl)-4,5-dihydrooxazole molecule important in chemical research or industry?

This molecule may have potential applications in pharmaceuticals or agrochemicals due to its unique structure and properties.