What is the molecular formula of the (S)-5,5'-Bis(diphenylphosphino)-2,2,2',2'-tetrafluoro-4,4'-bi-1,3-benzodioxole dichloromethane complex?
The molecular formula is C39H26Cl2F4O4P2.
What is the exact mass of the (S)-5,5'-Bis(diphenylphosphino)-2,2,2',2'-tetrafluoro-4,4'-bi-1,3-benzodioxole dichloromethane complex?
The exact mass is 766.0619513 g/mol.
How many hydrogen bond acceptor counts does the complex have?
The complex has 8 hydrogen bond acceptor counts.
What is the topological polar surface area of the complex?
The topological polar surface area is 36.9.
Can you provide the Canonical SMILES of the complex?
The Canonical SMILES is C1=CC=C(C=C1)P(C2=CC=CC=C2)C3=C(C4=C(C=C3)OC(O4)(F)F)C5=C(C=CC6=C5OC(O6)(F)F)P(C7=CC=CC=C7)C8=CC=CC=C8.C(Cl)Cl.
How many covalently-bonded unit counts does the (S)-5,5'-Bis(diphenylphosphino)-2,2,2',2'-tetrafluoro-4,4'-bi-1,3-benzodioxole dichloromethane complex have?
The complex has 2 covalently-bonded unit counts.
What is the molecular weight of the complex?
The molecular weight is 767.5 g/mol.
Does the complex contain any defined atom or bond stereocenters?
No, the complex does not contain any defined atom or bond stereocenters.
What is the IUPAC name of the (S)-5,5'-Bis(diphenylphosphino)-2,2,2',2'-tetrafluoro-4,4'-bi-1,3-benzodioxole dichloromethane complex?
The IUPAC name is dichloromethane;[4-(5-diphenylphosphanyl-2,2-difluoro-1,3-benzodioxol-4-yl)-2,2-difluoro-1,3-benzodioxol-5-yl]-diphenylphosphane.
Can you provide the InChIKey of the complex?
The InChIKey is WMDWJMFRHMAKPM-UHFFFAOYSA-N.
