(S)-5,5',6,6',7,7',8,8'-Octahydro-[1,1'-binaphthalene]-2,2'-diamine

Catalog Number	ACM229177780-1
CAS	229177-78-0
Structure
Synonyms	(1S)-5,5',6,6',7,7',8,8'-Octahydro-[1,1'-Binaphthalene]-2,2'-diamine
IUPAC Name	1-(2-amino-5,6,7,8-tetrahydronaphthalen-1-yl)-5,6,7,8-tetrahydronaphthalen-2-amine
Molecular Weight	292.00
Molecular Formula	C20H24N2
InChI	ISTHXJXFQJFWNS-UHFFFAOYSA-N
InChI Key	InChI=1S/C20H24N2/c21-17-11-9-13-5-1-3-7-15(13)19(17)20-16-8-4-2-6-14(16)10-12-18(20)22/h9-12H,1-8,21-22H2
Purity	98%
Appearance	White to off-white powder
Exact Mass	292.19400
Isomeric SMILES	C1CCC2=C(C1)C=CC(=C2C3=C(C=CC4=C3CCCC4)N)N

Q&A

What is the molecular weight of (S)-5,5',6,6',7,7',8,8'-Octahydro-[1,1'-binaphthalene]-2,2'-diamine?

The molecular weight is 292.42.

What are the synonyms for (S)-5,5',6,6',7,7',8,8'-Octahydro-[1,1'-binaphthalene]-2,2'-diamine?

The synonyms include (1S)-5,5',6,6',7,7',8,8'-octahydro-[1,1'-Binaphthalene]-2,2'-diamine and more.

What is the chemical formula of (S)-5,5',6,6',7,7',8,8'-Octahydro-[1,1'-binaphthalene]-2,2'-diamine?

The chemical formula is C20H24N2.

What is the predicted boiling point of (S)-5,5',6,6',7,7',8,8'-Octahydro-[1,1'-binaphthalene]-2,2'-diamine?

The predicted boiling point is 522.5±50.0 °C.

What is the predicted pka value of (S)-5,5',6,6',7,7',8,8'-Octahydro-[1,1'-binaphthalene]-2,2'-diamine?

The predicted pka value is 4.75±0.20.

What is the density of (S)-5,5',6,6',7,7',8,8'-Octahydro-[1,1'-binaphthalene]-2,2'-diamine?

The density is 1.156.

How many nitrogen atoms are present in the chemical formula of (S)-5,5',6,6',7,7',8,8'-Octahydro-[1,1'-binaphthalene]-2,2'-diamine?

There are 2 nitrogen atoms in the chemical formula.

What is the stereochemistry of (S)-5,5',6,6',7,7',8,8'-Octahydro-[1,1'-binaphthalene]-2,2'-diamine?

The stereochemistry is (S).

Based on the predicted boiling point, is (S)-5,5',6,6',7,7',8,8'-Octahydro-[1,1'-binaphthalene]-2,2'-diamine likely to be a solid or a liquid at room temperature?

It is likely to be a solid at room temperature.

In which solvents is (S)-5,5',6,6',7,7',8,8'-Octahydro-[1,1'-binaphthalene]-2,2'-diamine likely to be soluble based on its predicted properties?

It may be soluble in solvents with similar properties as indicated by its predicted pka value and density.